CAS 15971-95-6
:4-cyclohexyl-4-oxobutanoic acid
Description:
4-Cyclohexyl-4-oxobutanoic acid is an organic compound characterized by its cyclohexyl group and a ketone functional group adjacent to a carboxylic acid. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic cyclohexyl moiety. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its ketone functionality can also engage in nucleophilic addition reactions. The compound may exhibit moderate stability under standard conditions but can be sensitive to strong bases or acids, which could lead to hydrolysis or other degradation pathways. Additionally, 4-cyclohexyl-4-oxobutanoic acid may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features that can influence biological activity. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H16O3
InChI:InChI=1/C10H16O3/c11-9(6-7-10(12)13)8-4-2-1-3-5-8/h8H,1-7H2,(H,12,13)
SMILES:C1CCC(CC1)C(=O)CCC(=O)O
Synonyms:- Cyclohexanebutanoic Acid, Γ-Oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.