CymitQuimica logo

CAS 159719-57-0

:

4-fluoro-3-iodobenzonitrile

Description:
4-Fluoro-3-iodobenzonitrile is an organic compound characterized by the presence of a benzene ring substituted with both a fluorine atom and an iodine atom, as well as a nitrile group (-C≡N). The fluorine atom is located at the para position (4-position) relative to the nitrile group, while the iodine atom is at the meta position (3-position). This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and organic synthesis due to the reactivity of the nitrile group and the presence of halogen substituents, which can influence the compound's electronic properties and reactivity. The presence of both halogens can also affect the compound's polarity and solubility in various solvents. Additionally, 4-fluoro-3-iodobenzonitrile may exhibit interesting chemical behavior in reactions such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks typical of halogenated organic compounds.
Formula:C7H3FIN
InChI:InChI=1/C7H3FIN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H
InChI key:SXQVRZMBNRJTHU-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C#N)I)F
Synonyms:
  • Benzonitrile, 4-Fluoro-3-Iodo-
  • 4-Fluoro-3-iodobenzonitrile
Found 3 products.