CAS 1597403-47-8
:N,N′-trans-1,4-Cyclohexanediylbis[2-(4-chlorophenoxy)acetamide]
Description:
N,N′-trans-1,4-Cyclohexanediylbis[2-(4-chlorophenoxy)acetamide] is a synthetic organic compound characterized by its unique structural features, which include a cyclohexane backbone and two 4-chlorophenoxyacetamide functional groups. This compound is typically classified as an amide due to the presence of the amide functional group (-C(=O)N-). The trans configuration of the cyclohexane moiety contributes to its stereochemical properties, influencing its biological activity and potential applications. The presence of the 4-chlorophenoxy groups suggests that it may exhibit specific interactions with biological targets, potentially making it relevant in pharmaceutical research. Its molecular structure may also impart certain solubility and stability characteristics, which are critical for its behavior in various chemical environments. As with many synthetic compounds, understanding its reactivity, stability, and potential toxicity is essential for safe handling and application in research or industrial contexts. Further studies would be necessary to elucidate its complete profile, including its physical properties, biological activity, and potential uses.
Formula:C22H24Cl2N2O4
InChI:InChI=1/C22H24Cl2N2O4/c23-15-1-9-19(10-2-15)29-13-21(27)25-17-5-7-18(8-6-17)26-22(28)14-30-20-11-3-16(24)4-12-20/h1-4,9-12,17-18H,5-8,13-14H2,(H,25,27)(H,26,28)/t17-,18-
InChI key:InChIKey=HJGMCDHQPXTGAV-IYARVYRRNA-N
SMILES:N(C(COC1=CC=C(Cl)C=C1)=O)[C@H]2CC[C@H](NC(COC3=CC=C(Cl)C=C3)=O)CC2
Synonyms:- SMDC 750213
- N,N′-trans-1,4-Cyclohexanediylbis[2-(4-chlorophenoxy)acetamide]
- Acetamide, N,N′-trans-1,4-cyclohexanediylbis[2-(4-chlorophenoxy)-
- Trans-ISRIB
- ISRIB
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Acetamide, N,N'-trans-1,4-cyclohexanediylbis[2-(4-chlorophenoxy)-
CAS:Formula:C22H24Cl2N2O4Purity:98%Color and Shape:SolidMolecular weight:451.3430ISRIB (trans-isomer)
CAS:ISRIB (trans-isomer) is a potent inhibitor of PERK that rescues protein translation and prevents SG formation in the presence of P-eIF2α. Cost effective and quality assured.Formula:C22H24Cl2N2O4Purity:97.86% - 99.27%Color and Shape:SolidMolecular weight:451.34ISRIB
CAS:Controlled ProductApplications ISRIB is a potent and selective PERK inhibitor.
References Sidrauski, C., et al.: eLife, 2, e00498 (2013)Formula:C22H24Cl2N2O4Color and Shape:NeatMolecular weight:451.34Isrib
CAS:Isrib is a natural compound that inhibits protein translation and induces autophagy. Isrib has been shown to have synergistic effects on cells with other compounds, such as the natural compound caffeic acid phenethyl ester (CAPE). Isrib has also been shown to inhibit the mitochondrial membrane potential, leading to cell death. Isrib's ability to induce autophagy may be due to its inhibition of eif2b and its effect on the mitochondria. It also has inhibitory properties against pluripotent cells, which are stem cells that can differentiate into any type of cell in the body.
Formula:C22H24Cl2N2O4Purity:Min. 95%Molecular weight:451.35 g/mol




