CAS 159768-75-9
:Lobradimil
Description:
Lobradimil, with the CAS number 159768-75-9, is a synthetic peptide that functions primarily as a neuropeptide and is known for its potential therapeutic applications, particularly in the field of pain management and inflammation. It is characterized by its ability to modulate neurogenic inflammation and has been studied for its effects on sensory neurons. Lobradimil acts as an antagonist to certain receptors, influencing the release of neurotransmitters and neuropeptides involved in pain signaling pathways. Its structure typically includes a sequence of amino acids that contribute to its biological activity. The compound has been investigated in various preclinical and clinical studies, highlighting its potential in treating conditions such as neuropathic pain. However, as with many experimental drugs, further research is necessary to fully understand its efficacy, safety profile, and potential side effects. Overall, Lobradimil represents a promising area of study within the realm of pain therapeutics and neuropharmacology.
Formula:C49H75N15O12S
InChI:InChI=1/C49H75N15O12S/c1-76-31-14-12-28(13-15-31)21-29(24-57-34(47(74)75)9-3-17-56-49(53)54)59-43(70)37-10-4-18-62(37)45(72)36(27-65)61-41(68)35(23-32-7-6-20-77-32)60-40(67)25-58-42(69)39-22-30(66)26-64(39)46(73)38-11-5-19-63(38)44(71)33(50)8-2-16-55-48(51)52/h6-7,12-15,20,29-30,33-39,57,65-66H,2-5,8-11,16-19,21-27,50H2,1H3,(H,58,69)(H,59,70)(H,60,67)(H,61,68)(H,74,75)(H4,51,52,55)(H4,53,54,56)/t29-,30+,33-,34-,35-,36-,37-,38-,39-/m0/s1
Synonyms:- Rmp 7
- N~5~-(diaminomethylidene)ornithylprolyl-4-hydroxyprolylglycyl-3-(thiophen-2-yl)alanylseryl-N-[1-({1-carboxy-4-[(diaminomethylidene)amino]butyl}amino)-3-(4-methoxyphenyl)propan-2-yl]prolinamide
- N~5~-(diaminomethylidene)-L-ornithyl-L-prolyl-(4R)-4-hydroxy-L-prolylglycyl-3-thiophen-2-yl-L-alanyl-L-seryl-N-[(1S)-2-({(1S)-1-carboxy-4-[(diaminomethylidene)amino]butyl}amino)-1-(4-methoxybenzyl)ethyl]-L-prolinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(Hyp³,β-(2-thienyl)-Ala⁵,Tyr(Me)⁸-psi(CH₂NH)Arg⁹)-Bradykinin
CAS:Labradimil, Arg-Pro-Hyp-Gly-Thi-Ser-Pro-Tyr(Me)-psi(CH₂NH)-Arg, is a selective bradykinin B₂ receptor agonist with a longer plasma half-life than bradykinin. Labradimil transiently increases the permeability of the blood-brain barrier (BBB) to facilitate delivery of drugs to the CNS.Formula:C49H75N15O12SPurity:99.8%Color and Shape:Whitish PowderMolecular weight:1098.29Labradimil
CAS:<p>Labradimil, a bradykinin B2 agonist, boosts brain drug delivery and tumor survival rates.</p>Formula:C49H75N15O12SPurity:98%Color and Shape:SolidMolecular weight:1098.29(Hyp 3,b-(2-thienyl)-Ala5,Tyr(Me)8-psi(CH2NH)Arg9)-Bradykinin trifluoroacetate salt
CAS:<p>Bradykinin is a peptide hormone that is produced in the body and has various physiological effects, such as vasodilation, bronchoconstriction, and the release of histamine from mast cells. Bradykinin is also used in pharmacological treatments for malignant brain tumors, congestive heart failure, and epidermal growth factor-responsive dermatoses. Bradykinin can be administered intravenously or subcutaneously to treat these conditions. The drug can also be administered intraperitoneally to treat high blood pressure during pregnancy. Bradykinin is an ester of 3-b-(2-thienyl)-Ala5,Tyr(Me)8-psi(CH2NH)Arg9-OH with trifluoroacetic acid. It is synthesized by linking two molecules together through an ester bond. This drug has many beneficial effects on the human body due to its ability to inhibit enzymes that are involved in the production of prostagland</p>Formula:C49H75N15O12SPurity:Min. 95%Color and Shape:PowderMolecular weight:1,098.28 g/mol


