
CAS 15979-35-8
:Laccaic acid A
Description:
Laccaic acid A, with the CAS number 15979-35-8, is a natural organic compound primarily derived from the lac insect, which is known for producing lac resin. This compound belongs to the class of polyphenols and is characterized by its complex structure, which includes multiple hydroxyl groups and aromatic rings. Laccaic acid A exhibits notable antioxidant properties, making it of interest in various applications, including food preservation and cosmetics. It is also recognized for its potential antimicrobial activity. The compound is soluble in organic solvents but has limited solubility in water, which influences its applications in different fields. Additionally, laccaic acid A can undergo various chemical reactions, such as oxidation and esterification, which can modify its properties and enhance its utility in synthetic chemistry. Its unique characteristics and biological activities make it a subject of research in both natural product chemistry and pharmacology.
Formula:C26H19NO12
InChI:InChI=1S/C26H19NO12/c1-8(28)27-5-4-9-2-3-12(29)10(6-9)15-22(33)19-18(24(35)23(15)34)20(31)11-7-13(30)16(25(36)37)17(26(38)39)14(11)21(19)32/h2-3,6-7,29-30,33-35H,4-5H2,1H3,(H,27,28)(H,36,37)(H,38,39)
InChI key:InChIKey=IHLWXZNPOVMUFQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(C(=O)C=3C(C2=O)=C(O)C(=C(O)C3O)C4=CC(CCNC(C)=O)=CC=C4O)=CC(O)=C1C(O)=O
Synonyms:- 1,2-Anthracenedicarboxylic acid, 7-[5-(2-acetamidoethyl)-2-hydroxyphenyl]-9,10-dihydro-3,5,6,8-tetrahydroxy-9,10-dioxo-
- 1,2-Anthracenedicarboxylic acid, 7-[5-[2-(acetylamino)ethyl]-2-hydroxyphenyl]-9,10-dihydro-3,5,6,8-tetrahydroxy-9,10-dioxo-
- Laccaic acid A
- 7-[5-[2-(Acetylamino)ethyl]-2-hydroxyphenyl]-9,10-dihydro-3,5,6,8-tetrahydroxy-9,10-dioxo-1,2-anthracenedicarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Laccaic acid A
CAS:Laccaic acid A is a direct, DNA-competitive DNA methyltransferase 1 inhibitor.Formula:C26H19NO12Color and Shape:SolidMolecular weight:537.43
