CAS 159790-78-0

1-BENZYL-5-NITROIMIDAZOLE

Description:

1-Benzyl-5-nitroimidazole is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a benzyl group at the 1-position and a nitro group at the 5-position contributes to its unique chemical properties. This compound is typically a yellow to orange solid and is known for its potential biological activity, particularly in the field of medicinal chemistry. It may exhibit antimicrobial or antiprotozoal properties, making it of interest for pharmaceutical applications. The nitro group can participate in various chemical reactions, including reduction, which can lead to the formation of different derivatives. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions. As with many nitro-containing compounds, it is essential to handle 1-benzyl-5-nitroimidazole with care due to potential toxicity and environmental impact. Overall, its structural features and reactivity make it a valuable compound for research and development in various chemical and biological contexts.

Formula: C₁₀H₉N₃O₂

InChI: InChI=1/C10H9N3O2/c14-13(15)10-6-11-8-12(10)7-9-4-2-1-3-5-9/h1-6,8H,7H2

SMILES: c1ccc(cc1)Cn1cncc1N(=O)=O

Synonyms:

• 5-Nitro-1-(Phenylmethyl)-1H-Imidazole
• 1-benzyl-5-nitro-1H-imidazole

1-Benzyl-5-nitroimidazole

CAS: 159790-78-0

Formula: C₁₀H₉N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 203.1974

Ref: IN-DA001RDX

1-Benzyl-5-nitro-1H-imidazole

CAS: 159790-78-0

1-Benzyl-5-nitro-1H-imidazole

Molecular weight: 203.19736g/mol

Ref: 54-OR1020962

5-Nitro-1-(phenylmethyl)-1H-imidazole

Controlled Product

CAS: 159790-78-0

Applications 5-Nitro-1-(phenylmethyl)-1H-imidazole is an intermediate in the synthesis of nitroimidazole based compounds.
References Vidakovic, M., et al.: Antimicrob. Agents Chemother., 47, 302 (2003);

Formula: C₁₀H₉N₃O₂

Color and Shape: Neat

Molecular weight: 203.2

Ref: TR-N498055

1-Benzyl-5-nitro-1H-imidazole

CAS: 159790-78-0

Formula: C₁₀H₉N₃O₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 203.201

Ref: 10-F436682