CymitQuimica logo

CAS 159803-52-8

:

Ethyl 9H-fluorene-9-acetate

Description:
Ethyl 9H-fluorene-9-acetate is an organic compound characterized by its structure, which includes a fluorene moiety and an ester functional group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. The compound is known for its aromatic properties due to the presence of the fluorene structure, which contributes to its stability and potential applications in organic synthesis and materials science. Ethyl 9H-fluorene-9-acetate is generally soluble in organic solvents such as ethanol and dichloromethane, but it may have limited solubility in water. Its reactivity is influenced by the ester group, making it susceptible to hydrolysis under acidic or basic conditions. This compound may be utilized in various chemical reactions, including those involving nucleophilic substitutions or as a building block in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C17H16O2
InChI:InChI=1/C17H16O2/c1-2-19-17(18)11-16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16/h3-10,16H,2,11H2,1H3
InChI key:KSSIOELMUJKEML-UHFFFAOYSA-N
SMILES:CCOC(=O)CC1c2ccccc2c2ccccc12
Synonyms:
  • Fluorene-9H-acetic acid ethyl ester
  • ethyl 9H-fluoren-9-ylacetate
Found 3 products.