CymitQuimica logo

CAS 159856-61-8

:

4-(ethenyloxy)butyl [3-(triethoxysilyl)propyl]carbamate

Description:
4-(Ethenyloxy)butyl [3-(triethoxysilyl)propyl]carbamate, with the CAS number 159856-61-8, is a chemical compound that features both organic and inorganic components, making it a silane coupling agent. This substance typically exhibits characteristics such as a moderate molecular weight and a functional structure that includes an ethenyloxy group, a butyl chain, and a triethoxysilyl moiety. The presence of the carbamate functional group suggests potential reactivity, particularly in polymerization and cross-linking applications. It is often utilized in the formulation of coatings, adhesives, and sealants due to its ability to enhance adhesion between organic materials and inorganic substrates. Additionally, the triethoxysilyl group allows for bonding to silica or silicate surfaces, which is beneficial in various industrial applications. The compound is generally stable under standard conditions but may undergo hydrolysis in the presence of moisture, releasing ethanol and forming silanol groups that can further react with other materials. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C16H33NO6Si
InChI:InChI=1/C16H33NO6Si/c1-5-19-13-9-10-14-20-16(18)17-12-11-15-24(21-6-2,22-7-3)23-8-4/h5H,1,6-15H2,2-4H3,(H,17,18)
SMILES:C=COCCCCOC(=NCCC[Si](OCC)(OCC)OCC)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.