CAS 159871-54-2

1,1-Dimethylethyl α-aminocyclopropaneacetate

Description:

1,1-Dimethylethyl α-aminocyclopropaneacetate, also known by its CAS number 159871-54-2, is a chemical compound characterized by its unique structure that includes a cyclopropane ring and an amino acid derivative. This compound features a tert-butyl group, which contributes to its steric hindrance and influences its reactivity and solubility. It is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or agrochemicals. The presence of the amino group suggests potential biological activity, making it of interest in medicinal chemistry. Additionally, the cyclopropane moiety can impart unique strain-related properties, affecting the compound's stability and reactivity. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₉H₁₇NO₂

InChI: InChI=1S/C9H17NO2/c1-9(2,3)12-8(11)7(10)6-4-5-6/h6-7H,4-5,10H2,1-3H3

InChI key: InChIKey=KCUQSNWLGMSEOQ-UHFFFAOYSA-N

SMILES: C(C(OC(C)(C)C)=O)(N)C1CC1

Synonyms:

• Cyclopropaneacetic acid, α-amino-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl α-aminocyclopropaneacetate

tert-Butyl a-amino-cyclopropaneacetate

CAS: 159871-54-2

Formula: C₉H₁₇NO₂

Purity: 98%

Molecular weight: 171.2368

Ref: IN-DA01JMUR

Tert-butyl 2-amino-2-cyclopropylacetate

CAS: 159871-54-2

Tert-butyl 2-amino-2-cyclopropylacetate

Purity: 98%

Molecular weight: 171.24g/mol

Ref: 54-OR1036363

Tert-butyl 2-amino-2-cyclopropylacetate

CAS: 159871-54-2

Purity: 98%

Molecular weight: 171.2400055

Ref: 10-F740636