CAS 159878-02-1
:(2S,3R)-3-(N-Benzyloxycarbonyl)amino-1-chloro-4-phenylthiobutan-2-ol
Description:
The chemical substance known as (2S,3R)-3-(N-Benzyloxycarbonyl)amino-1-chloro-4-phenylthiobutan-2-ol, with the CAS number 159878-02-1, is a chiral compound featuring multiple functional groups, including an amino group, a chloro substituent, and a phenylthio moiety. Its structure indicates that it is likely to exhibit specific stereochemical properties due to the presence of chiral centers, which can influence its reactivity and interactions in biological systems. The benzyloxycarbonyl (Z) group serves as a protective group for the amino functionality, commonly used in peptide synthesis and organic chemistry to enhance stability and solubility. The presence of the phenylthio group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's chlorinated carbon may impart unique reactivity, making it a candidate for further chemical transformations. Overall, this compound's complex structure and functional diversity make it of interest in both synthetic and medicinal chemistry contexts.
Formula:C18H20ClNO3S
InChI:InChI=1S/C18H20ClNO3S/c19-11-17(21)16(13-24-15-9-5-2-6-10-15)20-18(22)23-12-14-7-3-1-4-8-14/h1-10,16-17,21H,11-13H2,(H,20,22)/t16-,17+/m0/s1
InChI key:InChIKey=YMCLVAZUQJPLTE-DLBZAZTESA-N
SMILES:[C@@H](CSC1=CC=CC=C1)(NC(OCC2=CC=CC=C2)=O)[C@@H](CCl)O
Synonyms:- (2S,3R)-(-)-3-(Benzyloxycarbonylamino)-1-chloro-4-phenylthiobutan-2-ol
- (2S,3R)-1-Chloro-2-hydroxy-3-[(benzyloxycarbonyl)amino]-4-(phenylthio)butane
- (2S,3R)-3-(N-Benzyloxycarbonyl)amino-1-chloro-4-phenylthiobutan-2-ol
- Benzyl (1R,2S)-3-Chloro-2-Hydroxy-1-(Phenylthiomethyl)Propylcarbamate
- CBZ-alcohol
- Carbamic acid, N-[(1R,2S)-3-chloro-2-hydroxy-1-[(phenylthio)methyl]propyl]-, phenylmethyl ester
- Carbamic acid, [(1R,2S)-3-chloro-2-hydroxy-1-[(phenylthio)methyl]propyl]-, phenylmethyl ester
- Carbamic acid, [3-chloro-2-hydroxy-1-[(phenylthio)methyl]propyl]-, phenylmethyl ester, [S-(R*,S*)]-
- Chloroalcohol
- benzyl {(1R,2S)-3-chloro-2-hydroxy-1-[(phenylsulfanyl)methyl]propyl}carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Benzyl ((2R,3S)-4-chloro-3-hydroxy-1-(phenylthio)butan-2-yl)carbamate
CAS:Formula:C18H20ClNO3SColor and Shape:SolidMolecular weight:365.8743(2S,3R)-3-Carbobenzyloxyamino-1-chloro-4-phenylthio-butan-2-ol
CAS:Controlled ProductFormula:C18H20ClNO3SColor and Shape:NeatMolecular weight:365.87

