CymitQuimica logo

CAS 15991-13-6

:

2H-1-Benzopyran-4-acetic acid, 7-hydroxy-2-oxo-, methyl ester

Description:
2H-1-Benzopyran-4-acetic acid, 7-hydroxy-2-oxo-, methyl ester, commonly referred to as methyl 7-hydroxy-2-oxo-2H-chromen-4-acetate, is a chemical compound characterized by its benzopyran structure, which is a fused ring system comprising a benzene ring and a pyran ring. This compound features a methyl ester functional group, contributing to its solubility and reactivity. It possesses a hydroxyl group at the 7-position, which can participate in hydrogen bonding, enhancing its potential biological activity. The presence of the keto group at the 2-position adds to its reactivity and stability. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and antioxidant activities. Its structural features suggest it may interact with various biological targets, making it a candidate for further research in drug development. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility can vary based on environmental conditions and purity.
Formula:C12H10O5
InChI:InChI=1S/C12H10O5/c1-16-11(14)4-7-5-12(15)17-10-6-8(13)2-3-9(7)10/h2-3,5-6,13H,4H2,1H3
InChI key:YRNMDWOVAZLMDY-UHFFFAOYSA-N
SMILES:COC(=O)CC1=CC(=O)OC2=C1C=CC(=C2)O
Found 4 products.