CAS 15991-59-0
:(+/-)-2-PROPYLPIPERIDINE HYDROCHLORIDE*
Description:
(+/-)-2-Propylpiperidine hydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a propyl group attached to the second carbon of the piperidine ring, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and other polar solvents. The compound exhibits chiral characteristics, meaning it exists as a racemic mixture of two enantiomers, which can have different biological activities. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. Additionally, the presence of the piperidine moiety is significant in drug design, as it is a common structural feature in many psychoactive and therapeutic agents. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity and the need for proper laboratory practices.
Formula:C8H18ClN
InChI:InChI=1/C8H17N.ClH/c1-2-5-8-6-3-4-7-9-8;/h8-9H,2-7H2,1H3;1H/t8-;/m0./s1
SMILES:CCC[C@H]1CCCCN1.Cl
Synonyms:- (2S)-2-Propylpipéridine chlorhydrate
- (2S)-2-Propylpiperidine hydrochloride
- (2S)-2-Propylpiperidine hydrochloride (1:1)
- (2S)-2-Propylpiperidinhydrochlorid
- (S)-2-Propylpiperidine hydrochloride
- piperidine, 2-propyl-, (2S)-, hydrochloride (1:1)
- Piperidine, 2-propyl-, hydrochloride, (S)-
- (2S)-2-propylpiperidinium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Piperidine, 2-propyl-, hydrochloride (1:1)
CAS:Formula:C8H18ClNPurity:95%Color and Shape:SolidMolecular weight:163.68822-Propylpiperidine Hydrochloride
CAS:2-Propylpiperidine HydrochloridePurity:98%Molecular weight:163.69g/molConiine hydrochloride
CAS:Coniine hydrochloride: toxic alkaloid, blocks acetylcholine receptors, impairs nervous system.Formula:C8H18ClNPurity:99.86%Color and Shape:SolidMolecular weight:163.70Ref: TM-TN3695
5mg49.00€10mg79.00€25mg143.00€50mg220.00€100mg346.00€200mg477.00€1mL*10mM (DMSO)44.00€Coniine hydrochloride
CAS:Natural alkaloidFormula:C8H17NHClPurity:≥ 95.0 % (GC)Color and Shape:PowderMolecular weight:163.692-Propylpiperidine hydrochloride
CAS:2-Propylpiperidine hydrochloride is a piperidine that is heterocyclic in nature and has the molecular formula C8H19N. It is obtained by the condensation of propionic acid with ammonia, followed by reaction with ethylene oxide. 2-Propylpiperidine hydrochloride is used as a starting material in the synthesis of other compounds such as coniine and its derivatives. The stereogenic center in 2-propylpiperidine hydrochloride can be synthesized using asymmetric methodology. The salt form of this compound is 2-propylpiperidine hydrochloride hydroxide (2-ppi) or 2-propylpiperidine hydrochloride hydrate. This compound can also exist as an alcohol, enantiopure, or amide form.Formula:C8H18ClNPurity:Min. 95%Molecular weight:163.69 g/mol





