CAS 159922-50-6
:4-METHOXYPHENYL 2,6-DI-O-BENZYL-BETA-D-GALACTOPYRANOSIDE
Description:
4-Methoxyphenyl 2,6-di-O-benzyl-β-D-galactopyranoside is a glycoside compound characterized by its structural components, which include a galactopyranoside sugar moiety and methoxyphenyl and benzyl groups. This compound typically exhibits properties associated with glycosides, such as solubility in organic solvents and potential biological activity. The presence of the methoxy group can influence its reactivity and interaction with biological systems, while the benzyl groups may enhance lipophilicity, affecting its pharmacokinetics. The compound may be of interest in medicinal chemistry and biochemistry due to its potential applications in drug development or as a biochemical probe. Its specific interactions, stability, and reactivity can vary based on environmental conditions and the presence of other chemical entities. As with many glycosides, it may also exhibit varying degrees of sweetness or taste modulation, depending on its structural configuration and the context of its use. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C27H30O7
InChI:InChI=1/C27H30O7/c1-30-21-12-14-22(15-13-21)33-27-26(32-17-20-10-6-3-7-11-20)25(29)24(28)23(34-27)18-31-16-19-8-4-2-5-9-19/h2-15,23-29H,16-18H2,1H3/t23-,24+,25+,26-,27-/m1/s1
Synonyms:- 4-Methoxyphenyl2,6-di-O-benzyl-b-D-galactopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
β-D-Galactopyranoside, 4-methoxyphenyl 2,6-bis-O-(phenylmethyl)-
CAS:Formula:C27H30O7Purity:%Color and Shape:SolidMolecular weight:466.52294-Methoxyphenyl 2,6-Di-O-benzyl-β-D-galactopyranoside
CAS:Formula:C27H30O7Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:466.534-Methoxyphenyl 2,6-di-O-benzyl-β-D-galactopyranoside
CAS:4-Methoxyphenyl 2,6-di-O-benzyl-β-D-galactopyranosideMolecular weight:466.5229g/mol4-Methoxyphenyl 2,6-di-O-benzyl-β-D-galactopyranoside
CAS:4-Methoxyphenyl 2,6-di-O-benzyl-b-D-galactopyranoside is a prodrug that is metabolized by esterases to the active form, 6-fluoro-3-indoxyl beta D galactopyranoside. This drug inhibits cancer cells and has been shown to cause cell death by inhibiting the production of proteins vital for cell division. It also induces inflammatory responses in cancer cells, which may be due to its ability to bind with cyclin D2 and uptake ternary complexes. 4MPBG also inhibits repair genes in human protein synthesis and microstructural changes in cancer cells.Formula:C27H30O7Purity:Min. 95%Molecular weight:466.52 g/mol




