CAS 159922-67-5
:4-METHOXYPHENYL 3,4-O-ISOPROPYLIDENE-BETA-D-GALACTOPYRANOSIDE
Description:
4-Methoxyphenyl 3,4-O-isopropylidene-β-D-galactopyranoside is a glycoside compound characterized by its structural features, which include a methoxyphenyl group and a galactopyranoside moiety protected by an isopropylidene group. This compound typically exhibits properties associated with both phenolic and carbohydrate structures, such as solubility in organic solvents and potential reactivity in glycosylation reactions. The presence of the methoxy group can influence its electronic properties, potentially enhancing its reactivity or stability. The isopropylidene protection serves to shield the hydroxyl groups on the galactopyranoside, making it more resistant to hydrolysis under certain conditions. This compound may be of interest in various fields, including medicinal chemistry and carbohydrate chemistry, due to its potential biological activities and applications in synthesizing more complex molecules. Its specific interactions, stability, and reactivity would depend on the surrounding conditions, such as pH and solvent, making it a versatile candidate for further research and application in synthetic chemistry.
Formula:C16H22O7
InChI:InChI=1/C16H22O7/c1-16(2)22-13-11(8-17)21-15(12(18)14(13)23-16)20-10-6-4-9(19-3)5-7-10/h4-7,11-15,17-18H,8H2,1-3H3/t11-,12-,13+,14-,15-/m1/s1
Synonyms:- 4-Methoxyphenyl3,4-O-isopropylidene-b-D-galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methoxyphenyl 3,4-o-isopropylidene-β-d-galactopyranoside
CAS:Formula:C16H22O7Purity:98%Color and Shape:SolidMolecular weight:326.34174-Methoxyphenyl 3,4-O-Isopropylidene-β-D-galactopyranoside
CAS:Formula:C16H22O7Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:326.354-Methoxyphenyl 3,4-O-isopropylidene-β-D-galactopyranoside
CAS:4-Methoxyphenyl 3,4-O-isopropylidene-β-D-galactopyranoside
Purity:98%Molecular weight:326.34g/mol4-Methoxyphenyl 3,4-O-isopropylidene-b-D-galactopyranoside
CAS:4-Methoxyphenyl 3,4-O-isopropylidene-b-D-galactopyranoside is a synthetic, conjugated prodrug that is metabolized to its active form by esterases. It has been shown to inhibit the h2 receptor and coagulation in vitro. 4-Methoxyphenyl 3,4-O-isopropylidene-b-D-galactopyranoside has also been shown to be a diagnostic marker for lymphocytic leukemia cells.Formula:C16H22O7Purity:Min. 95%Molecular weight:326.34 g/mol




