CAS 15993-42-7
:N-(5-Chloro-2-methoxyphenyl)-2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanamide
Description:
N-(5-Chloro-2-methoxyphenyl)-2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanamide, with the CAS number 15993-42-7, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as amides, azo groups, and methoxy and nitro substituents. This compound typically exhibits properties associated with azo dyes, including vibrant coloration and potential applications in dyeing and pigment formulations. The presence of the chloro and nitro groups can influence its reactivity and solubility, making it of interest in various chemical and biological studies. Additionally, the methoxy groups may enhance its lipophilicity, affecting its interaction with biological systems. The compound's stability, solubility, and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, this substance is notable for its potential applications in fields such as materials science, pharmaceuticals, and analytical chemistry, particularly in the development of colorimetric sensors or as intermediates in organic synthesis.
Formula:C18H17ClN4O6
InChI:InChI=1S/C18H17ClN4O6/c1-10(24)17(18(25)20-14-8-11(19)4-7-15(14)28-2)22-21-13-6-5-12(23(26)27)9-16(13)29-3/h4-9,17H,1-3H3,(H,20,25)
InChI key:InChIKey=AYOFXUHULUCJBF-UHFFFAOYSA-N
SMILES:N(C(C(N=NC1=C(OC)C=C(N(=O)=O)C=C1)C(C)=O)=O)C2=C(OC)C=CC(Cl)=C2
Synonyms:- 11745
- Butanamide, N-(5-chloro-2-methoxyphenyl)-2-[(2-methoxy-4-nitrophenyl)azo]-3-oxo-
- Butanamide, N-(5-chloro-2-methoxyphenyl)-2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-3-oxo-
- Hasna Brilliant Yellow 7GX
- Irgalite Yellow F 4G
- N-(5-Chloro-2-methoxyphenyl)-2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanamide
- N-(5-chloro-2-methoxyphenyl)-2-[(2-methoxy-4-nitrophenyl)azo]-3-oxo-Butanamide
- N-(5-chloro-2-methoxyphenyl)-2-[(E)-(2-methoxy-4-nitrophenyl)diazenyl]-3-oxobutanamide
- P.Y.111
- Pigment Yellow 111
- o-Acetoacetanisidide, 5′-chloro-2-[(2-methoxy-4-nitrophenyl)azo]-
- C.I.Pigment Yellow 111
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Butanamide, N-(5-chloro-2-methoxyphenyl)-2-[2-(2-methoxy-4-nitrophenyl)diazenyl]-3-oxo-
CAS:Formula:C18H17ClN4O6Molecular weight:420.8038Pigment Yellow 111
CAS:Pigment Yellow 111 is a hydrophobic, micrometer-sized pigment with a bathochromic color. It has functional groups and additives that impart metal ion tolerance and pH stability. Pigment Yellow 111 also has an acidic surface and is soluble in fatty acids, chlorine, and silicon. Pigment Yellow 111 can be used as a coating or as an additive to produce electrostatic toner in electrophotographic applications.
Formula:C18H17CIN4O6Purity:Min. 95%Molecular weight:524.27 g/mol

