CAS 1599432-39-9

2-[2-Fluoro-6-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-[2-Fluoro-6-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a fluorinated aromatic substituent. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and interactions in various chemical environments. This compound is likely to exhibit properties typical of dioxaborolanes, such as being a stable, cyclic boronate ester, which can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The fluorine atoms in the aromatic ring can impart unique electronic properties, potentially making it useful in medicinal chemistry and materials science. Additionally, the steric bulk provided by the tetramethyl groups may affect its reactivity and solubility. Overall, this compound's distinctive characteristics make it a subject of interest in synthetic organic chemistry and related fields.

Formula: C₁₃H₁₅BF₄O₂

InChI: InChI=1S/C13H15BF4O2/c1-11(2)12(3,4)20-14(19-11)10-8(13(16,17)18)6-5-7-9(10)15/h5-7H,1-4H3

InChI key: InChIKey=LXQQKRJENINXPG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(B2OC(C)(C)C(C)(C)O2)C(F)=CC=C1

Synonyms:

• 2-[2-Fluoro-6-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
• 2-Fluoro-6-(trifluoromethyl)phenylboronic acid pinacol ester
• 1,3,2-Dioxaborolane, 2-[2-fluoro-6-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-

1,3,2-Dioxaborolane, 2-[2-fluoro-6-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-

CAS: 1599432-39-9

Formula: C₁₃H₁₅BF₄O₂

Purity: 95%

Molecular weight: 290.0616

Ref: IN-DA01K62J

2-Fluoro-6-(trifluoromethyl)phenylboronic acid pinacol ester

CAS: 1599432-39-9

Purity: ≥95%

Molecular weight: 290.0599976

Ref: 10-F627562