CymitQuimica logo

CAS 1599440-06-8

:

9H-Fluoren-9-ylmethyl N-[2-[[(acetyloxy)methyl]amino]-2-oxoethyl]carbamate

Description:
9H-Fluoren-9-ylmethyl N-[2-[[(acetyloxy)methyl]amino]-2-oxoethyl]carbamate, with the CAS number 1599440-06-8, is a chemical compound characterized by its complex structure, which includes a fluorenyl group, an acetyloxy moiety, and a carbamate functional group. This compound is typically used in organic synthesis and medicinal chemistry due to its potential biological activity. The presence of the fluorenyl group contributes to its stability and hydrophobic characteristics, while the carbamate and acetyloxy functionalities may enhance its reactivity and solubility in various solvents. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can influence its behavior in biological systems. Additionally, the specific arrangement of functional groups may impart unique pharmacological properties, making it a candidate for further research in drug development. As with many synthetic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity under certain conditions.
Formula:C20H20N2O5
InChI:InChI=1S/C20H20N2O5/c1-13(23)27-12-22-19(24)10-21-20(25)26-11-18-16-8-4-2-6-14(16)15-7-3-5-9-17(15)18/h2-9,18H,10-12H2,1H3,(H,21,25)(H,22,24)
InChI key:InChIKey=NKDSPEFADHLMHN-UHFFFAOYSA-N
SMILES:C(OC(NCC(NCOC(C)=O)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:
  • 9H-Fluoren-9-ylmethyl N-[2-[[(acetyloxy)methyl]amino]-2-oxoethyl]carbamate
  • (2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)acetamido)methyl acetate
  • Carbamic acid, N-[2-[[(acetyloxy)methyl]amino]-2-oxoethyl]-, 9H-fluoren-9-ylmethyl ester
  • (2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]acetamido)methyl acetate
Found 6 products.