CymitQuimica logo

CAS 1599440-11-5

:

Fmoc-GGFG-Dxd

Description:
Fmoc-GGFG-Dxd is a synthetic peptide that incorporates the Fmoc (9-fluorenylmethoxycarbonyl) protecting group, which is commonly used in peptide synthesis to protect the amino group of the amino acids during the coupling process. The sequence "GGFG" indicates a series of amino acids, specifically glycine and phenylalanine, which can contribute to the peptide's structural and functional properties. The "Dxd" portion suggests the presence of a non-standard amino acid or a modification, which may impart unique characteristics such as altered solubility, stability, or biological activity. This compound is typically utilized in research settings, particularly in studies related to peptide chemistry, drug design, and bioconjugation. Its specific properties, such as solubility, stability, and reactivity, would depend on the overall structure and the environment in which it is used. As with many peptides, its biological activity can be influenced by factors such as conformation and interactions with other biomolecules.
Formula:C57H55FN8O12
InChI:InChI=1S/C57H55FN8O12/c1-3-57(75)40-20-45-52-37(25-66(45)54(72)39(40)27-77-55(57)73)51-42(18-17-32-30(2)41(58)21-43(65-52)50(32)51)63-49(70)28-76-29-62-47(68)22-60-53(71)44(19-31-11-5-4-6-12-31)64-48(69)24-59-46(67)23-61-56(74)78-26-38-35-15-9-7-13-33(35)34-14-8-10-16-36(34)38/h4-16,20-21,38,42,44,75H,3,17-19,22-29H2,1-2H3,(H,59,67)(H,60,71)(H,61,74)(H,62,68)(H,63,70)(H,64,69)/t42-,44-,57-/m0/s1
InChI key:TVZRZUVAYRAILT-XWCAFGSDSA-N
SMILES:CC[C@@]1(C2=C(COC1=O)C(=O)N3CC4=C5[C@H](CCC6=C5C(=CC(=C6C)F)N=C4C3=C2)NC(=O)COCNC(=O)CNC(=O)[C@H](CC7=CC=CC=C7)NC(=O)CNC(=O)CNC(=O)OCC8C9=CC=CC=C9C1=CC=CC=C81)O
Synonyms:
  • Glycinamide, N-[(9H-fluoren-9-ylmethoxy)carbonyl]glycylglycyl-L-phenylalanyl-N-[[2-[[(1S,9S)-9-ethyl-5-fluoro-2,3,9,10,13,15-hexahydro-9-hydroxy-4-methyl-10,13-dioxo-1H,12H-benzo[de]pyrano[3',4':6,7]indolizino[1,2-b]quinolin-1-yl]amino]-2-oxoethoxy]methyl]-
  • Exatecan-2-(aminomethoxy)acetamide-Gly-Phe-Gly-Gly-Fmoc
  • Fmoc-GGFG-Dxd
Found 4 products.