CAS 159950-96-6

1-[[(4-Methylphenyl)sulfonyl]oxy]-1,2-benziodoxol-3(1H)-one

Description:

1-[[(4-Methylphenyl)sulfonyl]oxy]-1,2-benziodoxol-3(1H)-one, commonly referred to as a benziodoxole derivative, is a chemical compound characterized by its unique structural features, including a benziodoxole core and a sulfonyl group. This compound typically exhibits properties such as high stability and reactivity, particularly in oxidation reactions. The presence of the sulfonyl group enhances its electrophilic character, making it useful in various synthetic applications, including organic synthesis and as a reagent in chemical transformations. Additionally, the compound may display solubility in organic solvents, which is advantageous for its use in laboratory settings. Its applications often extend to the fields of medicinal chemistry and materials science, where it can serve as an intermediate or a catalyst. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed. Overall, this compound represents a valuable tool in synthetic organic chemistry due to its distinctive reactivity and functional group characteristics.

Formula: C₁₄H₁₁IO₅S

InChI: InChI=1/C14H11IO5S/c1-10-6-8-11(9-7-10)21(17,18)20-15-13-5-3-2-4-12(13)14(16)19-15/h2-9H,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)OI1c2ccccc2C(=O)O1

Synonyms:

• 1-{[(4-methylphenyl)sulfonyl]oxy}-1lambda~3~,2-benziodoxol-3(1H)-one

1,2-Benziodoxol-3(1H)-one, 1-[[(4-methylphenyl)sulfonyl]oxy]-

CAS: 159950-96-6

Formula: C₁₄H₁₁IO₅S

Molecular weight: 418.2036

Ref: IN-DA001RJM

1-[[(4-Methylphenyl)sulphonyl]oxy]-1,2-benziodoxol-3(1H)-one

CAS: 159950-96-6

1-[[(4-Methylphenyl)sulphonyl]oxy]-1,2-benziodoxol-3(1H)-one

Purity: ≥95%

Molecular weight: 418.20g/mol

Ref: 54-OR7137