CAS 159954-28-6
:Salmon Glucoside
Description:
Salmon Glucoside, identified by the CAS number 159954-28-6, is a chemical compound derived from salmon, primarily known for its potential applications in the cosmetic and pharmaceutical industries. This substance is a glycoside, which means it consists of a sugar moiety linked to a non-sugar component, typically a phenolic compound. Salmon Glucoside is recognized for its antioxidant properties, which can help protect cells from oxidative stress and may contribute to skin health by promoting hydration and elasticity. Additionally, it is often explored for its potential anti-aging effects, making it a popular ingredient in skincare formulations. The compound is generally considered safe for topical use, although individual reactions can vary. Its solubility characteristics and stability in various formulations are important for its efficacy in products. Overall, Salmon Glucoside represents a blend of natural origin and functional benefits, aligning with the growing trend towards incorporating bioactive ingredients in health and beauty products.
Formula:C14H16ClNO6
InChI:InChI=1/C14H16ClNO6/c15-6-1-2-7-8(3-6)16-4-9(7)21-14-13(20)12(19)11(18)10(5-17)22-14/h1-4,10-14,16-20H,5H2/t10-,11-,12+,13-,14+/m1/s1
Synonyms:- 6-Chloro-3-indoxyl-beta-D-glucopyranoside
- Salmon-beta-D-glucoside
- 6-chloro-1H-indol-3-yl alpha-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Chloro-3-indolyl β-D-glucopyranoside
CAS:6-Chloro-3-indolyl β-D-glucopyranosideFormula:C14H16ClNO6Purity:>99% (tlc) (Typical Value in Batch COA)Color and Shape: white powderMolecular weight:329.73294g/mol6-Chloro-3-indolyl b-D-glucopyranoside
CAS:Formula:C14H16ClNO6Purity:(HPLC) ≥ 98.0%Color and Shape:White to off-white crystalline powderMolecular weight:329.736-Chloro-3-indolyl-β-D-glucopyranoside
CAS:<p>M04102 - 6-Chloro-3-indolyl-beta-D-glucopyranoside</p>Formula:C14H16ClNO6Purity:98%Color and Shape:Solid, No data available.Molecular weight:329.736-Chloro-3-indoxyl-β-D-glucopyranoside
CAS:Chromogenic substrate for β-D-glucosidase. Yields a red precipitate upon cleavage.Formula:C14H18ClNO7Purity:Min. 98 Area-%Molecular weight:347.75 g/mol




