CAS 159954-35-5: 6-CHLORO-3-INDOXYL CAPRYLATE
Description:6-Chloro-3-indoxyl caprylate is a chemical compound that belongs to the class of indoxyl esters, which are often utilized in biochemical applications, particularly in the field of microbiology and histochemistry. This compound features a chlorinated indoxyl moiety, which contributes to its reactivity and potential applications as a chromogenic substrate. The caprylate group, derived from caprylic acid, enhances its solubility and stability in various solvents, making it suitable for use in enzymatic assays. The presence of the chlorine atom in the structure can influence the compound's electronic properties and reactivity, potentially affecting its interaction with biological systems. Typically, compounds like 6-chloro-3-indoxyl caprylate are used in the detection of specific enzymes, such as β-galactosidase, where they can produce a colored product upon enzymatic cleavage. Overall, this compound is characterized by its unique structural features that facilitate its role in biochemical research and diagnostics.
Formula:C16H20ClNO2
InChI:InChI=1S/C16H20ClNO2/c1-2-3-4-5-6-7-16(19)20-15-11-18-14-10-12(17)8-9-13(14)15/h8-11,18H,2-7H2,1H3
InChI key:InChIKey=KBOGGXOQZZEFSL-UHFFFAOYSA-N
SMILES:O=C(OC1=CNC=2C=C(Cl)C=CC12)CCCCCCC
- Synonyms:
- 6-Chloro-1H-indol-3-yl octanoate
- 6-Chloro-3-Indoxyl Octanoate
- Octanoic acid, 6-chloro-1H-indol-3-yl ester
- Rarechem Ah Bs 0029
- Salmon(Tm)-Caprylate
Octanoic acid, 6-chloro-1H-indol-3-yl ester
Ref: IN-DA001RJJ
| Undefined size | To inquire |
6-Chloro-3-indoxyl caprylate
Ref: 3D-C-4820
| Undefined size | To inquire |
6-Chloro-1H-indol-3-yl octanoate
Ref: 3D-EC32006
| 1g | 470.00 € | ||
| 2g | 725.00 € | ||
| 5g | 1,452.00 € | ||
| 10g | 2,424.00 € | ||
| 25g | 3,839.00 € |
6-Chloro-3-Indolyl-Caprylate (Salmon Caprylate) for molecular biology, 97%
Ref: SR-99721
| 50mg | 84.00 € |
