CAS 15996-22-2

3,6-dimethylidenepiperazine-2,5-dione

Description:

3,6-Dimethylidenepiperazine-2,5-dione, also known as a derivative of piperazine, is characterized by its unique bicyclic structure that includes a piperazine ring with two carbonyl groups (ketones) at the 2 and 5 positions, along with two methylidene groups at the 3 and 6 positions. This compound typically exhibits a solid state at room temperature and is known for its potential reactivity due to the presence of the carbonyl functionalities, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The presence of the dimethylidene groups contributes to its stability and influences its solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis often involves the manipulation of piperazine derivatives and careful control of reaction conditions to achieve the desired structural modifications. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₆H₆N₂O₂

InChI: InChI=1/C6H6N2O2/c1-3-5(9)8-4(2)6(10)7-3/h1-2H2,(H,7,10)(H,8,9)

SMILES: C=c1c(nc(=C)c(n1)O)O

2,5-Diazabicyclo[2.2.1]heptane-3,6-dione

CAS: 15996-22-2

Formula: C₅H₆N₂O₂

Color and Shape: Solid

Molecular weight: 126.1133

Ref: IN-DA001RJV

Cycloserine Impurity 5 (3,6-Dimethylene-2,5-piperazinedione)

CAS: 15996-22-2

Formula: C₆H₆N₂O₂

Molecular weight: 138.13

Ref: 4Z-C-11308

3,6-Methylene-2,5-piperazinedione

Controlled Product

CAS: 15996-22-2

Applications 3,6-Methylene-2,5-piperazinedione is an impurity of Cycloserine (C988800), an antibacterial agent.
References Ajo, D., et al.: J. Molec. Structure.,141, 415 (1986); Gentry-Weeks, C., et al.: J. Biol. Chem., 268, 7298 (1993); Alexander, F., et al.: Eur. J. Biochem., 219, 953 (1994); Auger, S., et al.: Biochimie, 87, 231 (2005)

Formula: C₆H₆N₂O₂

Color and Shape: Neat

Molecular weight: 138.12

Ref: TR-M304240

3,6-Dimethylene-2,5-piperazinedione

CAS: 15996-22-2

3,6-Methylene-2,5-piperazinedione is a heterocyclic compound that belongs to the piperazinedione ring system. It is synthesized from 3,6-dithiobenzoic acid and thioacetic acid. The synthesis of this compound proceeds through a series of reactions involving oxidation of the thioacetic acid to the dithiols, followed by a sequence of nucleophilic substitution reactions.

Formula: C₆H₆N₂O₂

Purity: Min. 95%

Molecular weight: 138.12 g/mol

Ref: 3D-QAA99622

3,6-Methylene-2,5-piperazinedione

CAS: 15996-22-2

Formula: C₆H₆N₂O₂

Molecular weight: 138.12

Ref: ST-EA-CP-C86012