CAS 159979-97-2
:1-(azidomethyl)-3-fluoro-benzene
Description:
1-(Azidomethyl)-3-fluoro-benzene, with the CAS number 159979-97-2, is an organic compound characterized by the presence of both an azide group and a fluorine atom attached to a benzene ring. The azidomethyl group (-CH2N3) introduces a highly reactive azide functional group, which can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The fluorine atom, located at the meta position relative to the azidomethyl group, can influence the compound's reactivity and polarity, often enhancing its electrophilic character. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a versatile building block. Additionally, the presence of both azide and fluorine functionalities may impart unique properties, such as increased stability or altered solubility in different solvents. Safety precautions are essential when handling this compound, as azides can be hazardous and potentially explosive under certain conditions.
Formula:C7H7FN3
InChI:InChI=1/C7H6FN3/c8-7-3-1-2-6(4-7)5-10-11-9/h1-4H,5H2
SMILES:c1cc(cc(c1)F)CN=[N+]=[NH-]
Synonyms:- 1-(Azidomethyl)-3-Fluorobenzene
- Benzene, 1-(Azidomethyl)-3-Fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-(azidomethyl)-3-fluorobenzene
CAS:Formula:C7H6FN3Purity:95.0%Color and Shape:Liquid, No data available.Molecular weight:151.1441-(Azidomethyl)-3-fluorobenzene
CAS:1-(Azidomethyl)-3-fluorobenzene is a cycloaddition product that, when optimized, has a high efficiency for the synthesis of phosphine containing target compounds. The cycloaddition reaction is carried out in an organic solvent at room temperature with or without the addition of an external base. The reaction time can be varied from 10 minutes to 2 hours. The substituent on the azide and alkyne can be varied to produce different products. 1-(Azidomethyl)-3-fluorobenzene is catalyzed by copper(II) acetate and zinc chloride or copper(II) oxide and zinc chloride to form the desired phosphines.
Formula:C7H6FN3Purity:Min. 95%Molecular weight:151.14 g/mol

