CAS 15998-93-3: 5,5-dimethyl-2-thioxoimidazolidin-4-one
Description:5,5-Dimethyl-2-thioxoimidazolidin-4-one, with the CAS number 15998-93-3, is a heterocyclic compound characterized by its imidazolidinone structure, which features a five-membered ring containing both nitrogen and sulfur atoms. This compound typically exhibits a thioxo functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential applications in organic synthesis. The presence of two methyl groups at the 5-position enhances its steric properties and may influence its solubility and stability. Generally, compounds of this type can be involved in various chemical reactions, including nucleophilic substitutions and cyclization processes. They may also exhibit biological activity, making them of interest in medicinal chemistry. The physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the substance. Overall, 5,5-dimethyl-2-thioxoimidazolidin-4-one is a versatile compound with potential applications in both synthetic and pharmaceutical chemistry.
Formula:C5H8N2OS
InChI:InChI=1/C5H8N2OS/c1-5(2)3(8)6-4(9)7-5/h1-2H3,(H2,6,7,8,9)

5,5-dimethyl-2-sulfanylideneimidazolidin-4-one
Ref: IN-DA01JWOB
1g | 202.00 € | ||
5g | To inquire | ||
100mg | 98.00 € | ||
250mg | 129.00 € |

Ref: 54-OR92982
1g | 237.00 € | ||
5g | 761.00 € | ||
250mg | 114.00 € |

5,5-Dimethyl-2-thioxoimidazolidin-4-one
Ref: 10-F615002
1g | 90.00 € | ||
5g | 260.00 € | ||
250mg | 43.00 € |