CAS 16000-65-0
:7,8-Tetradecanediol
Description:
7,8-Tetradecanediol is a long-chain aliphatic diol characterized by the presence of two hydroxyl (-OH) functional groups located on the seventh and eighth carbon atoms of a tetradecane backbone. This compound is typically a colorless, viscous liquid or solid at room temperature, depending on its specific form and purity. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic alkyl chain. The presence of hydroxyl groups imparts some degree of polarity, allowing it to participate in hydrogen bonding, which can influence its physical properties and reactivity. 7,8-Tetradecanediol is often utilized in the formulation of surfactants, emulsifiers, and as a lubricant in various industrial applications. Additionally, it may serve as an intermediate in the synthesis of other chemical compounds. Its safety profile indicates that it should be handled with care, as with many organic chemicals, to avoid potential irritation or adverse effects upon exposure.
Formula:C14H30O2
InChI:InChI=1S/C14H30O2/c1-3-5-7-9-11-13(15)14(16)12-10-8-6-4-2/h13-16H,3-12H2,1-2H3
InChI key:InChIKey=XKZGHFFSJSBUFA-UHFFFAOYSA-N
SMILES:C(C(CCCCCC)O)(CCCCCC)O
Synonyms:- 7,8-Tetradecanediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
