CymitQuimica logo

CAS 160001-92-3

:

1-(4-fluorophenyl)cyclopentanamine

Description:
1-(4-Fluorophenyl)cyclopentanamine, identified by its CAS number 160001-92-3, is an organic compound characterized by the presence of a cyclopentane ring substituted with a 4-fluorophenyl group and an amine functional group. This compound typically exhibits a molecular structure that includes a five-membered cyclopentane ring, which contributes to its unique three-dimensional conformation. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in various solvents. As an amine, it may participate in hydrogen bonding, affecting its physical properties such as boiling and melting points. The compound's potential applications could span various fields, including medicinal chemistry, where it may serve as a scaffold for drug development or as a research tool in studying biological systems. However, specific biological activity, toxicity, and environmental impact would require further investigation to fully understand its characteristics and potential uses.
Formula:C11H14FN
InChI:InChI=1/C11H14FN/c12-10-5-3-9(4-6-10)11(13)7-1-2-8-11/h3-6H,1-2,7-8,13H2
SMILES:C1CCC(C1)(c1ccc(cc1)F)N
Synonyms:
  • Cyclopentanamine, 1-(4-Fluorophenyl)-
  • 1-(4-Fluorophenyl)cyclopentanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.