CAS 160009-37-0
:Methyl 2-amino-4-(4-fluorophenyl)-6-(1-methylethyl)-5-pyrimidinecarboxylate
Description:
Methyl 2-amino-4-(4-fluorophenyl)-6-(1-methylethyl)-5-pyrimidinecarboxylate, with the CAS number 160009-37-0, is a chemical compound characterized by its pyrimidine core structure, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of a 4-fluorophenyl substituent enhances its potential biological activity, while the isopropyl group at the 6-position may influence its steric properties and interactions with biological targets. The amino group at the 2-position can participate in hydrogen bonding, making it a potential candidate for various pharmaceutical applications. Overall, this compound's unique structural features suggest it may exhibit interesting pharmacological properties, warranting further investigation in medicinal chemistry and drug development.
Formula:C15H16FN3O2
InChI:InChI=1S/C15H16FN3O2/c1-8(2)12-11(14(20)21-3)13(19-15(17)18-12)9-4-6-10(16)7-5-9/h4-8H,1-3H3,(H2,17,18,19)
InChI key:InChIKey=RMYXELUYVYVDAI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(=NC(N)=NC1C(C)C)C2=CC=C(F)C=C2
Synonyms:- Methyl 2-amino-4-(4-fluorophenyl)-6-(1-methylethyl)-5-pyrimidinecarboxylate
- 5-Pyrimidinecarboxylic acid, 2-amino-4-(4-fluorophenyl)-6-(1-methylethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Methyl 2-amino-4-(4-fluorophenyl)-6-isopropylpyrimidine-5-carboxylate
CAS:Formula:C15H16FN3O2Molecular weight:289.3048Methyl 2-Amino-4-(4-fluorophenyl)-6-isopropylpyrimidine-5-carboxylate
CAS:Controlled ProductFormula:C15H16FN3O2Color and Shape:NeatMolecular weight:289.305Methyl 2-amino-4-(4-fluorophenyl)-6-isopropylpyrimidine-5-carboxylate
CAS:Formula:C15H16FN3O2Molecular weight:289.31


