CAS 16001-93-7
:Tetramethyl methylenediphosphonate
Description:
Tetramethyl methylenediphosphonate, with the CAS number 16001-93-7, is an organophosphorus compound characterized by its structure, which includes two phosphonate groups linked by a methylene bridge. This compound is typically a colorless to pale yellow liquid and is soluble in polar organic solvents. It exhibits properties that make it useful in various applications, including as a chelating agent and in the synthesis of other phosphorus-containing compounds. The presence of multiple methyl groups enhances its stability and solubility, while the phosphonate groups contribute to its reactivity, particularly in coordination chemistry. Tetramethyl methylenediphosphonate can interact with metal ions, forming stable complexes, which is valuable in fields such as catalysis and materials science. Additionally, it may have applications in agriculture as a potential herbicide or fungicide due to its biological activity. However, handling this compound requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures in laboratory and industrial settings.
Formula:C5H14O6P2
InChI:InChI=1/C5H14O6P2/c1-8-12(6,9-2)5-13(7,10-3)11-4/h5H2,1-4H3
SMILES:COP(=O)(CP(=O)(OC)OC)OC
Synonyms:- Methylenediphosphonic acid tetramethyl ester
- Tetramethyl Methanediylbis(Phosphonate)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Tetramethyl methylenediphosphonate, 98+%
CAS:Tetramethyl methylenediphosphonate is used in the preparation of phosphonate analogue of ribose-1-phosphate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original AlFormula:C5H14O6P2Purity:98+%Color and Shape:Liquid or viscous liquid, Clear colorless to pale yellowMolecular weight:232.11Phosphonic acid, P,P'-methylenebis-, P,P,P',P'-tetramethyl ester
CAS:Formula:C5H14O6P2Purity:96%Color and Shape:LiquidMolecular weight:232.1086Ref: IN-DA001RLY
1g30.00€5g77.00€10g131.00€25g192.00€50g260.00€100g583.00€250gTo inquire500gTo inquire250mg25.00€Tetramethyl Methylenebis(Phosphonate)
CAS:Tetramethyl Methylenebis(Phosphonate)Purity:98%Molecular weight:232.11g/molTetramethyl Methylenebis(phosphonate)
CAS:Controlled ProductApplications Tetramethyl methylenebis(phosphonate) (cas# 16001-93-7) is a useful research chemical.
Formula:C5H14O6P2Color and Shape:NeatMolecular weight:232.1Methylenebis-phosphonic acid tetramethyl ester
CAS:Methylenebisphosphonic acid is a phosphonic acid with an inhibitory effect on enzymes. It has been shown to have strong inhibitory properties against gram-negative bacteria and inhibits the growth of Mycobacterium tuberculosis. Methylenebisphosphonic acid also inhibits the production of cytokines, such as tumor necrosis factor-α (TNF-α) and interleukin-1β (IL-1β), by inflammatory cells, which may contribute to its anti-inflammatory properties. Methylenebisphosphonic acid also blocks apoptotic cell death by inhibiting the activation of caspase 3, an enzyme that cleaves other proteins involved in apoptosis. Methylenebisphosphonic acid binds to Ca2+ response proteins and blocks their ability to regulate cellular processes. This prevents the release of cytochrome C from mitochondria, which initiates a cascade of reactions leading to cell death.Formula:C5H14O6P2Purity:Min. 95%Molecular weight:232.11 g/mol






