CAS 16004-43-6
:2-Nitrobenzaldehyde derivative of Semicarbazide
Description:
2-Nitrobenzaldehyde derivative of Semicarbazide, with the CAS number 16004-43-6, is a chemical compound that features a semicarbazide moiety attached to a 2-nitrobenzaldehyde structure. This compound typically exhibits characteristics common to both the aldehyde and nitro functional groups, such as reactivity towards nucleophiles due to the electrophilic nature of the carbonyl group and the electron-withdrawing effect of the nitro group. It is often used in organic synthesis and may serve as an intermediate in the preparation of various pharmaceuticals and agrochemicals. The presence of the nitro group can influence the compound's solubility, stability, and reactivity, making it a valuable building block in synthetic chemistry. Additionally, derivatives of semicarbazide are known for their ability to form hydrazones and other condensation products, which can be useful in various chemical applications. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C8H8N4O3
InChI:InChI=1/C8H8N4O3/c9-8(13)11-10-5-6-3-1-2-4-7(6)12(14)15/h1-5H,(H3,9,11,13)/b10-5+
Synonyms:- 2-Nitrobenzaldehyde Semicarbazone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
Hydrazinecarboxamide, 2-[(2-nitrophenyl)methylene]-
CAS:Formula:C8H8N4O3Color and Shape:SolidMolecular weight:208.17412-Nitrobenzaldehyde Semicarbazone (Standard)
CAS:2-Nitrobenzaldehyde Semicarbazone (Standard) is the standard substance of 2-Nitrobenzaldehyde Semicarbazone, and it is applicable for quantitative analysis, quality control, and related research in biochemical experiments. 2-Nitrobenzaldehyde Semicarbazone is a metabolite marker for the detection of Nitrofurazone, a highly restricted antibiotic. This compound, derived from Semicarbazide, exhibits significant potential in identifying the presence of Nitrofurazone.Formula:C8H8N4O3Color and Shape:SolidMolecular weight:208.172-Nitrobenzaldehyde Semicarbazone
CAS:2-Nitrobenzaldehyde Semicarbazone, a Semicarbazide derivative, detects antibiotic Nitrofurazone use.Formula:C8H8N4O3Color and Shape:SolidMolecular weight:208.172-Nitrobenzaldehyde Semicarbazone
CAS:Controlled ProductFormula:C8H8N4O3Color and Shape:NeatMolecular weight:208.17



