CAS 16006-65-8
:6-Methyl-9-β-D-xylofuranosyl-9H-purine
Description:
6-Methyl-9-β-D-xylofuranosyl-9H-purine, with the CAS number 16006-65-8, is a purine nucleoside derivative characterized by the presence of a methyl group at the 6-position of the purine ring and a β-D-xylofuranosyl sugar moiety. This compound exhibits properties typical of nucleosides, including the ability to participate in biochemical processes such as nucleic acid synthesis and metabolism. Its structural features contribute to its potential biological activity, which may include roles in cellular signaling or as a substrate for various enzymes. The presence of the xylofuranosyl sugar distinguishes it from other nucleosides, potentially influencing its interaction with nucleic acid polymerases and other biomolecules. Additionally, the methyl group can affect the compound's solubility, stability, and overall reactivity. As a purine derivative, it may also be involved in various pharmacological applications, although specific therapeutic uses would depend on further research and characterization. Overall, this compound represents an interesting subject for studies in biochemistry and medicinal chemistry.
Formula:C11H14N4O4
InChI:InChI=1S/C11H14N4O4/c1-5-7-10(13-3-12-5)15(4-14-7)11-9(18)8(17)6(2-16)19-11/h3-4,6,8-9,11,16-18H,2H2,1H3/t6-,8+,9-,11-/m1/s1
InChI key:InChIKey=FIGBCBGMUIGJBD-DYUFWOLASA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(C)N=CN3)O[C@H](CO)[C@@H]1O
Synonyms:- 9H-Purine, 6-methyl-9-β-D-xylofuranosyl-
- NSC102254
- 6-Methyl-9-β-D-xylofuranosylpurine
- NSC 102254
- 6-Methyl-9-β-D-xylofuranosyl-9H-purine
- 6-Methyl-9-b-D-xylofuranosylpurine
- 6-Methyl-9-(beta-D-xylofuranosyl)purine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Methyl-9-(β-D-xylofuranosyl)purine
CAS:Nucleoside Derivatives - Xylo-nucleosides; 6-Modified purine nucleosidesFormula:C11H14N4O4Color and Shape:SolidMolecular weight:266.25
