CAS 160067-63-0
:O-(2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-b-D-glucopyranosyl)-N- a-(fluoren-9-yl-methoxy carbonyl)-L-serine
Description:
The chemical substance known as O-(2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-b-D-glucopyranosyl)-N-α-(fluoren-9-ylmethoxycarbonyl)-L-serine is a complex glycosylated amino acid derivative. It features a glucopyranosyl moiety that is heavily acetylated, which enhances its solubility and stability. The presence of the fluorenylmethoxycarbonyl (Fmoc) group indicates that this compound is likely used in peptide synthesis, as Fmoc is a common protecting group for amino acids. The L-serine component contributes to its biological relevance, as serine is a non-essential amino acid involved in various metabolic processes. This compound may exhibit specific biological activities due to its structural features, including potential interactions with proteins or enzymes. Its synthesis and characterization would typically involve techniques such as NMR spectroscopy and mass spectrometry to confirm the structure and purity. Overall, this substance represents a sophisticated molecule that combines carbohydrate and amino acid chemistry, making it of interest in fields such as medicinal chemistry and biochemistry.
Formula:C32H36N2O13
InChI:InChI=1/C32H36N2O13/c1-16(35)33-27-29(46-19(4)38)28(45-18(3)37)26(15-42-17(2)36)47-31(27)43-14-25(30(39)40)34-32(41)44-13-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-12,24-29,31H,13-15H2,1-4H3,(H,33,35)(H,34,41)(H,39,40)/t25-,26?,27+,28-,29-,31-/m1/s1
Synonyms:- FmocSer(Ac3-b-D-GlcNAc)-OH
- FmocSer(Ac3--D-GlcNAc)-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Fmoc-Ser(GlcNAc(Ac)₃-β-D)-OH
CAS:Bachem ID: 4042305.
Formula:C32H36N2O13Purity:99.5%Color and Shape:White PowderMolecular weight:656.64L-Serine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-[3,4,6-tri-O-acetyl-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]-
CAS:Formula:C32H36N2O13Purity:98%Color and Shape:SolidMolecular weight:656.6338Fmoc-L-Ser(β-D-GlcNAc(Ac)3)-OH
CAS:Fmoc-L-Ser(β-D-GlcNAc(Ac)3)-OHPurity:98%Molecular weight:656.64g/molFmoc-Ser(β-D-GlcNAc(Ac)3)-OH
CAS:Formula:C32H36N2O13Purity:≥ 95.0%Color and Shape:White to off-white solidMolecular weight:656.632-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranosyl-Fmoc serine
CAS:2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranosyl Fmoc serine is a modified sugar that is synthesized by the glycosylation of 2,3,4,6-tetra‑O‑acetyl‑2‑deoxy‑α‑D‑glucopyranose with an amino acid. It is used in peptide synthesis and as a building block for other oligosaccharides and saccharides. This compound has been shown to be useful in the production of complex carbohydrates.Formula:C32H36N2O13Purity:Min. 95 Area-%Color and Shape:White To Off-White SolidMolecular weight:656.63 g/molO-(2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranosyl)-N-Fmoc-L-serine
CAS:Controlled ProductFormula:C32H36N2O13Color and Shape:NeatMolecular weight:656.63





