CymitQuimica logo

CAS 16013-14-2

:

1,2,4-Oxadiazole, 3-(4-nitrophenyl)-

Description:
1,2,4-Oxadiazole, 3-(4-nitrophenyl)- is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring structure. The compound features a nitrophenyl group at the 3-position of the oxadiazole ring, contributing to its chemical reactivity and potential applications. It is typically a crystalline solid, exhibiting moderate solubility in organic solvents. The presence of the nitro group enhances its electron-withdrawing properties, which can influence its reactivity in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. This compound is of interest in medicinal chemistry and materials science due to its potential biological activities and utility in synthesizing other complex molecules. Safety data indicates that it should be handled with care, as nitro compounds can be hazardous. Overall, 1,2,4-Oxadiazole, 3-(4-nitrophenyl)- is a versatile compound with significant implications in research and development.
Formula:C8H5N3O3
InChI:InChI=1S/C8H5N3O3/c12-11(13)7-3-1-6(2-4-7)8-9-5-14-10-8/h1-5H
InChI key:KWOHXJCKLMGBFD-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C2=NOC=N2)[N+](=O)[O-]
Found 4 products.