
CAS 160135-92-2
:Gemopatrilat
Description:
Gemopatrilat is a synthetic compound that belongs to the class of angiotensin-converting enzyme (ACE) inhibitors, primarily developed for the treatment of hypertension and heart failure. It functions by inhibiting the activity of ACE, which plays a crucial role in the renin-angiotensin-aldosterone system (RAAS), leading to vasodilation and reduced blood pressure. The chemical structure of gemopatrilat includes a unique combination of functional groups that contribute to its pharmacological activity. It is characterized by its ability to improve cardiovascular outcomes by decreasing peripheral resistance and promoting better blood flow. Additionally, gemopatrilat has been studied for its potential protective effects on renal function, particularly in patients with diabetic nephropathy. As with many ACE inhibitors, it may have side effects such as cough, elevated potassium levels, and potential allergic reactions. Overall, gemopatrilat represents a significant advancement in the management of cardiovascular diseases, although its clinical use may vary based on regulatory approvals and ongoing research.
Formula:C19H26N2O4S
InChI:InChI=1S/C19H26N2O4S/c1-19(2)10-6-9-14(18(25)21(19)12-16(22)23)20-17(24)15(26)11-13-7-4-3-5-8-13/h3-5,7-8,14-15,26H,6,9-12H2,1-2H3,(H,20,24)(H,22,23)/t14-,15-/m0/s1
InChI key:InChIKey=YRSVDSQRGBYVIY-GJZGRUSLSA-N
SMILES:C(C(O)=O)N1C(=O)[C@@H](NC([C@H](CC2=CC=CC=C2)S)=O)CCCC1(C)C
Synonyms:- (6S)-Hexahydro-6-[[(2S)-2-mercapto-1-oxo-3-phenylpropyl]amino]-2,2-dimethyl-7-oxo-1H-azepine-1-acetic acid
- 1H-Azepine-1-acetic acid, hexahydro-6-[(2-mercapto-1-oxo-3-phenylpropyl)amino]-2,2-dimethyl-7-oxo-, [S-(R*,R*)]-
- 1H-Azepine-1-acetic acid, hexahydro-6-[[(2S)-2-mercapto-1-oxo-3-phenylpropyl]amino]-2,2-dimethyl-7-oxo-, (6S)-
- Gemopatrilat
- BMS 189921
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Gemopatrilat
CAS:<p>Gemopatrilat is a an vasopeptidase inhibitor.</p>Formula:C19H26N2O4SColor and Shape:SolidMolecular weight:378.49
