CAS 160146-17-8: Finrozole

Description:Finrozole, with the CAS number 160146-17-8, is a chemical compound that belongs to the class of non-steroidal antiandrogens. It is primarily recognized for its potential use in the treatment of conditions related to androgen excess, such as certain types of prostate cancer. Finrozole functions by inhibiting the action of androgens, which are male hormones that can promote the growth of hormone-sensitive tumors. The compound exhibits a specific mechanism of action that involves blocking androgen receptors, thereby reducing the biological effects of androgens in target tissues. In terms of its physical properties, Finrozole is typically characterized by its molecular structure, which includes various functional groups that contribute to its pharmacological activity. Safety and efficacy profiles are essential for any therapeutic agent, and ongoing research continues to evaluate its potential applications in clinical settings. As with any chemical substance, proper handling and adherence to safety guidelines are crucial when working with Finrozole in laboratory or medical environments.

Formula:C₁₈H₁₅FN₄O

InChI:InChI=1/C18H15FN4O/c19-16-7-3-13(4-8-16)9-17(24)18(23-12-21-11-22-23)15-5-1-14(10-20)2-6-15/h1-8,11-12,17-18,24H,9H2/t17-,18+/s2

InChI key:InChIKey=SLJZVZKQYSKYNV-ZVOYONDMNA-N

SMILES:N#CC1=CC=C(C=C1)C(N2N=CN=C2)C(O)CC3=CC=C(F)C=C3

Synonyms:
Benzonitrile, 4-[(1R,2S)-3-(4-fluorophenyl)-2-hydroxy-1-(1H-1,2,4-triazol-1-yl)propyl]-, rel-
Benzonitrile, 4-[3-(4-fluorophenyl)-2-hydroxy-1-(1H-1,2,4-triazol-1-yl)propyl]-, (R*,S*)-
Finrozole
MPV-2213ad
rel-4-[(1R,2S)-3-(4-Fluorophenyl)-2-hydroxy-1-(1H-1,2,4-triazol-1-yl)propyl]benzonitrile

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Finrozole REF: 54-BUP03435CAS: 160146-17-8	99.9%	1,096.00 €~3,807.00 €	Wed 16 Apr 25
Finrozole REF: 3D-FF102319CAS: 160146-17-8	Min. 95%	To inquire	Mon 28 Apr 25
Finrozole REF: TM-T27320CAS: 160146-17-8	100%	128.00 €~2,812.00 €	Tue 03 Jun 25