CAS 16015-73-9
:1-(3,4-Dimethoxyphenyl)piperazine
Description:
1-(3,4-Dimethoxyphenyl)piperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of the 3,4-dimethoxyphenyl group indicates that two methoxy (-OCH3) substituents are attached to a phenyl ring at the 3 and 4 positions, contributing to its unique chemical properties. This compound is typically classified as a piperazine derivative and may exhibit psychoactive properties, making it of interest in pharmacological research. Its molecular structure suggests potential interactions with various neurotransmitter systems, particularly in the central nervous system. The compound is often studied for its effects on mood and cognition, and it may have implications in the development of therapeutic agents. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors in its application and study. Safety and handling precautions are essential due to its potential biological activity.
Formula:C12H18N2O2
InChI:InChI=1S/C12H18N2O2/c1-15-11-4-3-10(9-12(11)16-2)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3
InChI key:InChIKey=XYJCQRIUCCQSKC-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1OC)N2CCNCC2
Synonyms:- Piperazine, 1-(3,4-dimethoxyphenyl)-
- 1-(3,4-Dimethoxyphenyl)piperazine
- 4-(3,4-Dimethoxyphenyl)piperazine
- N-(3,4-Dimethoxyphenyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(3,4-Dimethoxyphenyl)piperazine-d6
CAS:Controlled ProductFormula:C12D6H12N2O2Color and Shape:NeatMolecular weight:228.321
