CAS 16019-34-4: 4-Chloro-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidine
Description:4-Chloro-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. The presence of a chloro substituent at the 4-position and a phenylmethyl group at the 7-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may also display various functional properties, such as fluorescence or reactivity with nucleophiles, due to the electron-withdrawing nature of the chloro group and the aromatic character of the phenylmethyl moiety. Overall, 4-Chloro-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidine is a compound of interest for further research in pharmacology and synthetic chemistry.
Formula:C13H10ClN3
InChI:InChI=1S/C13H10ClN3/c14-12-11-6-7-17(13(11)16-9-15-12)8-10-4-2-1-3-5-10/h1-7,9H,8H2
InChI key:InChIKey=KMWWCJXJJNHTQL-UHFFFAOYSA-N
SMILES:ClC1=NC=NC2=C1C=CN2CC=3C=CC=CC3
- Synonyms:
- 7H-Pyrrolo[2,3-d]pyrimidine, 4-chloro-7-(phenylmethyl)-
- 4-Chloro-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidine
- 7H-Pyrrolo[2,3-d]pyrimidine, 7-benzyl-4-chloro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 7-BENZYL-4-CHLORO-7H-PYRROLO[2,3-D] PYRIMIDINE REF: IN-DA00ABX1CAS: 16019-34-4 | 99% | To inquire | Wed 16 Apr 25 |
![]() | 7-Benzyl-4-Chloro-7H-Pyrrolo[2,3-D] Pyrimidine REF: 54-OR1025004CAS: 16019-34-4 | 99% | 47.00 €~993.00 € | Thu 17 Apr 25 |
![]() | 7-BENZYL-4-CHLORO-7H-PYRROLO[2,3-D] PYRIMIDINE REF: 10-F334035CAS: 16019-34-4 | 95.0% | To inquire | Mon 28 Apr 25 |
![]() | 9-Benzyl-6-chloro-7-deazapurine REF: 3D-FB33318CAS: 16019-34-4 | Min. 95% | - - - | Discontinued product |

7-BENZYL-4-CHLORO-7H-PYRROLO[2,3-D] PYRIMIDINE
Ref: IN-DA00ABX1
1g | 112.00 € | ||
5g | 295.00 € | ||
25g | To inquire | ||
250mg | 65.00 € |

Ref: 54-OR1025004
1g | 95.00 € | ||
5g | 326.00 € | ||
25g | 993.00 € | ||
250mg | 47.00 € |

7-BENZYL-4-CHLORO-7H-PYRROLO[2,3-D] PYRIMIDINE
Ref: 10-F334035
250mg | To inquire |

9-Benzyl-6-chloro-7-deazapurine
Ref: 3D-FB33318
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |