CAS 160210-22-0
:2-[(2-cyano-1,1,2-trideuterio-ethyl)amino]-3-methyl-butanoic acid
Description:
2-[(2-Cyano-1,1,2-trideuterio-ethyl)amino]-3-methyl-butanoic acid, with the CAS number 160210-22-0, is a synthetic organic compound characterized by its unique structure that includes a cyano group and a branched amino acid backbone. This compound features a trideuterated ethyl group, which indicates the presence of three deuterium atoms, enhancing its utility in isotopic labeling studies. The presence of the amino group suggests that it can participate in various chemical reactions typical of amino acids, such as peptide bond formation. The carboxylic acid functional group contributes to its acidic properties, making it soluble in polar solvents. Its structural complexity allows for potential applications in biochemical research, particularly in studies involving metabolic pathways or drug development. Additionally, the presence of the cyano group may impart specific reactivity, making it a candidate for further chemical modifications. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, with implications for both research and industrial applications.
Formula:C8H11D3N2O2
InChI:InChI=1/C8H14N2O2/c1-6(2)7(8(11)12)10-5-3-4-9/h6-7,10H,3,5H2,1-2H3,(H,11,12)/i3D,5D2
SMILES:CC(C)C(C(=O)O)NC(C(C#N)[2H])([2H])[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N-(2-Cyanoethyl-d3)-L-valine
CAS:Controlled ProductApplications A labelled metabolite of Acrylonitrile.
References Peter, H., et al.: Carcinogenesis, 4, 235 (1983), Fennell, T., et al.: Chem. Res. Toxicol., 4, 678 (1991), Kedderis, G., et al.: Toxicol. Appl. Pharmacol., 120, 288 (1993),Formula:C82H3H11N2O2Color and Shape:NeatMolecular weight:173.23L-Valine, N-(2-cyanoethyl-1,1,2-d3)- (9CI)
CAS:Formula:C8H11D3N2O2Color and Shape:SolidMolecular weight:173.2274


