
CAS 16022-70-1
:Dequalinium salicylate
Description:
Dequalinium salicylate is a chemical compound that combines the properties of dequalinium, a quaternary ammonium compound, with salicylate, a derivative of salicylic acid. It is primarily known for its antiseptic and antimicrobial properties, making it useful in various pharmaceutical applications, particularly in topical formulations. The compound exhibits a broad spectrum of activity against bacteria and fungi, which is beneficial in treating infections. Dequalinium salicylate is typically presented as a white to off-white powder and is soluble in water, which enhances its applicability in liquid formulations. Its mechanism of action involves disrupting microbial cell membranes, leading to cell death. Additionally, it may possess anti-inflammatory properties due to the salicylate component, which can help alleviate irritation associated with infections. Safety and efficacy profiles are essential for its use, and it is generally well-tolerated when used as directed. However, like all chemical substances, it should be handled with care, following appropriate safety guidelines.
Formula:C30H40N4·2C7H5O3
InChI:InChI=1S/C30H38N4.C7H6O3/c1-23-21-27(31)25-15-9-11-17-29(25)33(23)19-13-7-5-3-4-6-8-14-20-34-24(2)22-28(32)26-16-10-12-18-30(26)34;8-6-4-2-1-3-5(6)7(9)10/h9-12,15-18,21-22,31-32H,3-8,13-14,19-20H2,1-2H3;1-4,8H,(H,9,10)/p+1
InChI key:InChIKey=KIQDGIBPMHOGMD-UHFFFAOYSA-O
SMILES:C(CCCCCCCCC[N+]=1C2=C(C(N)=CC1C)C=CC=C2)[N+]=3C4=C(C(N)=CC3C)C=CC=C4.C([O-])(=O)C1=C(O)C=CC=C1
Synonyms:- Benzoic acid, 2-hydroxy-, ion(1-), 1,1′-(1,10-decanediyl)bis[4-amino-2-methylquinolinium] (2:1)
- Quinolinium, 1,1′-(1,10-decanediyl)bis[4-amino-2-methyl-, salt with 2-hydroxybenzoic acid (1:2)
- Quinaldinium, 1,1′-decamethylenebis[4-amino-, disalicylate
- Quinolinium, 1,1′-(1,10-decanediyl)bis[4-amino-2-methyl-, 2-hydroxybenzoate (1:2)
- Salicylic acid, ion(1-), 1,1′-decamethylenebis[4-aminoquinaldinium]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Quinolinium, 1,1'-(1,10-decanediyl)bis[4-amino-2-methyl-, 2-hydroxybenzoate (1:2)
CAS:Formula:C44H50N4O6Molecular weight:730.891Decalinium salycilate
CAS:Decalinium salycilate is a biochemical.Formula:C37H45N4O3Color and Shape:SolidMolecular weight:593.78

