CymitQuimica logo

CAS 160227-12-3

:

[(2S,3R,4S,5S,6S)-4,5-diacetoxy-6-(4-methoxyphenoxy)-3-[(2S,3S,4S,5S,6S)-3,4,5-triacetoxy-6-(acetoxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]methyl acetate

Description:
The chemical substance with the name "[(2S,3R,4S,5S,6S)-4,5-diacetoxy-6-(4-methoxyphenoxy)-3-[(2S,3S,4S,5S,6S)-3,4,5-triacetoxy-6-(acetoxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]methyl acetate" and CAS number "160227-12-3" is a complex organic compound characterized by multiple functional groups, including acetoxy and methoxy moieties, which suggest potential reactivity and biological activity. The presence of tetrahydropyran rings indicates a cyclic structure that contributes to its stereochemistry, with specific stereocenters denoted by the (S) and (R) configurations. This compound may exhibit solubility in organic solvents due to its hydrophobic aromatic components, while the acetoxy groups could enhance its reactivity in esterification or hydrolysis reactions. Its intricate structure suggests potential applications in medicinal chemistry or as a synthetic intermediate, although specific biological activities or uses would require further investigation. Overall, the compound's complexity and functional diversity make it an interesting subject for study in organic synthesis and pharmacology.
Formula:C33H42O19
InChI:InChI=1/C33H42O19/c1-15(34)42-13-24-26(44-17(3)36)28(45-18(4)37)31(48-21(7)40)33(51-24)52-27-25(14-43-16(2)35)50-32(49-23-11-9-22(41-8)10-12-23)30(47-20(6)39)29(27)46-19(5)38/h9-12,24-33H,13-14H2,1-8H3/t24-,25-,26-,27+,28-,29-,30-,31-,32+,33-/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.