CymitQuimica logo

CAS 160233-27-2

:

5-(Isoxazol-3-yl)thiophene-2-sulfonyl chloride

Description:
5-(Isoxazol-3-yl)thiophene-2-sulfonyl chloride is a chemical compound characterized by its unique structural features, which include a thiophene ring, an isoxazole moiety, and a sulfonyl chloride functional group. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its reactivity due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis and medicinal chemistry. The isoxazole ring contributes to its potential biological activity, as heterocycles often play significant roles in pharmacology. Additionally, the compound may exhibit properties such as solubility in organic solvents and stability under specific conditions, although it may be sensitive to moisture due to the sulfonyl chloride functionality. Overall, 5-(Isoxazol-3-yl)thiophene-2-sulfonyl chloride is a versatile intermediate in the synthesis of various chemical entities, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C7H4ClNO3S2
InChI:InChI=1S/C7H4ClNO3S2/c8-14(10,11)7-2-1-6(13-7)5-3-4-12-9-5/h1-4H
InChI key:InChIKey=XDOOPXTYGCQGOE-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1SC(=CC1)C=2C=CON2
Synonyms:
  • 5-(3-Isoxazolyl)thiophene-2-sulfonyl chloride
  • 2-(Isoxazol-3-yl)thiophene-5-sulfonyl chloride
  • 5-(3-Isoxazolyl)-2-thiophenesulfonyl chloride
  • 2-Thiophenesulfonyl chloride, 5-(3-isoxazolyl)-
  • 5-(Isoxazol-3-yl)thiophene-2-sulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.