CAS 160233-42-1

METHYL (R)-1-TRITYL-2-AZIRIDINECARBOXYLATE

Description:

Methyl (R)-1-trityl-2-aziridinecarboxylate is a chemical compound characterized by its aziridine ring, which is a three-membered cyclic amine. The presence of the trityl group indicates that it has a bulky aromatic substituent, enhancing its stability and influencing its reactivity. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules due to its unique structural features. The aziridine moiety is known for its ability to participate in various chemical reactions, including ring-opening reactions, which can lead to the formation of diverse functional groups. The methyl ester functionality suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid. Additionally, the (R) configuration denotes a specific stereochemistry, which can be crucial in determining the compound's biological activity and interaction with other molecules. Overall, methyl (R)-1-trityl-2-aziridinecarboxylate is a valuable intermediate in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₂₃H₂₁NO₂

InChI: InChI=1/C23H21NO2/c1-26-22(25)21-17-24(21)23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21H,17H2,1H3/t21-,24?/m1/s1

SMILES: COC(=O)[C@H]1CN1C(c1ccccc1)(c1ccccc1)c1ccccc1

Synonyms:

• methyl (2R)-1-tritylaziridine-2-carboxylate
• (R)-1-Trityl-Aziridine-2-Carboxylic Acid Methyl Ester

(R)-1-Trityl-aziridine-2-carboxylic acid methyl ester

CAS: 160233-42-1

Formula: C₂₃H₂₁NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 343.4183

Ref: IN-DA001RSI

Methyl (2R)-1-(triphenylmethyl)aziridine-2-carboxylate

CAS: 160233-42-1

Methyl (2R)-1-(triphenylmethyl)aziridine-2-carboxylate

Purity: 98%

Molecular weight: 343.42g/mol

Ref: 54-OR95799

METHYL (R)-1-TRITYL-2-AZIRIDINECARBOXYLATE

CAS: 160233-42-1

Purity: 97.0%

Color and Shape: Liquid, No data available.

Molecular weight: 343.4259948730469

Ref: 10-F303308