CymitQuimica logo

CAS 160233-42-1

:

METHYL (R)-1-TRITYL-2-AZIRIDINECARBOXYLATE

Description:
Methyl (R)-1-trityl-2-aziridinecarboxylate is a chemical compound characterized by its aziridine ring, which is a three-membered cyclic amine. The presence of the trityl group indicates that it has a bulky aromatic substituent, enhancing its stability and influencing its reactivity. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules due to its unique structural features. The aziridine moiety is known for its ability to participate in various chemical reactions, including ring-opening reactions, which can lead to the formation of diverse functional groups. The methyl ester functionality suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid. Additionally, the (R) configuration denotes a specific stereochemistry, which can be crucial in determining the compound's biological activity and interaction with other molecules. Overall, methyl (R)-1-trityl-2-aziridinecarboxylate is a valuable intermediate in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C23H21NO2
InChI:InChI=1/C23H21NO2/c1-26-22(25)21-17-24(21)23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21H,17H2,1H3/t21-,24?/m1/s1
InChI key:QGSITPKXYQEFIR-CILPGNKCSA-N
SMILES:COC(=O)[C@H]1CN1C(c1ccccc1)(c1ccccc1)c1ccccc1
Synonyms:
  • methyl (2R)-1-tritylaziridine-2-carboxylate
  • (R)-1-Trityl-Aziridine-2-Carboxylic Acid Methyl Ester
Found 4 products.