CAS 1603-02-7
:4-Pyrimidinol, 2,5,6-triamino-, 4-(hydrogen sulfate)
Description:
4-Pyrimidinol, 2,5,6-triamino-, 4-(hydrogen sulfate), also known by its CAS number 1603-02-7, is a chemical compound that features a pyrimidine ring substituted with amino groups and a hydrogen sulfate moiety. This compound is characterized by its ability to act as a weak acid due to the presence of the hydrogen sulfate group, which can dissociate in solution. The amino groups contribute to its basicity and potential for forming hydrogen bonds, influencing its solubility and reactivity in various solvents. It is often studied for its biological activity, particularly in relation to its role in nucleic acid metabolism and potential pharmaceutical applications. The presence of multiple functional groups allows for diverse interactions in biochemical systems, making it of interest in medicinal chemistry. Additionally, its stability and reactivity can be affected by pH and temperature, which are important considerations in experimental settings. Overall, this compound exemplifies the complexity of heterocyclic chemistry and its implications in biological systems.
Formula:C4H7N5O4S
InChI:InChI=1S/C4H7N5O4S/c5-1-2(6)8-4(7)9-3(1)13-14(10,11)12/h5H2,(H,10,11,12)(H4,6,7,8,9)
InChI key:InChIKey=DJUGBKWOBAOTFA-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)O)C=1C(N)=C(N)N=C(N)N1
Synonyms:- 4-Pyrimidinol, 2,5,6-triamino-, 4-(hydrogen sulfate)
- 4-Pyrimidinol, 2,5,6-triamino-, hydrogen sulfate
- (Triaminopyrimidin-4-yl)oxidanesulfonic acid
- 2,5,6-Triaminopyrimidin-4-yl hydrogen sulfate
- 4-Pyrimidinol, 2,5,6-triamino-, hydrogen sulfate (ester)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,5,6-Triaminopyrimidin-4-yl hydrogen sulfate
CAS:Formula:C4H7N5O4SPurity:95%Color and Shape:SolidMolecular weight:221.19456-Hydroxy 2,4,5-Triaminopyrimidine Sulfate
CAS:Controlled ProductApplications 6-Hydroxy 2,4,5-Triaminopyrimidine Sulfate (cas# 1603-02-7) is a compound useful in organic synthesis.
Formula:C4H7N5O4SColor and Shape:NeatMolecular weight:221.192,5,6-Triaminopyrimidin-4-ol sulphate
CAS:2,5,6-Triaminopyrimidin-4-ol sulphate is a fine chemical that is used as a reagent in the synthesis of other compounds. It can be used as a building block for research chemicals and speciality chemicals such as pesticides. This compound is also useful in the manufacture of pharmaceuticals and agrochemicals. 2,5,6-Triaminopyrimidin-4-ol sulphate has been shown to react with aniline derivatives to produce a variety of products including pyrrolidine and piperidine derivatives. This versatile compound can also be used as a scaffold in the synthesis of complex molecules.
Formula:C4H7N5O4SPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:221.2 g/mol2,5,6-Triaminopyrimidin-4-yl hydrogen sulfate
CAS:Formula:C4H7N5O4SPurity:95%+Molecular weight:221.19



