CAS 16031-82-6
:2-aminoethanethiol - hex-1-enofuranos-3-ulose (1:1)
Description:
2-Aminoethanethiol-hex-1-enofuranos-3-ulose (1:1), with the CAS number 16031-82-6, is a chemical compound that features both amino and thiol functional groups, which contribute to its reactivity and potential biological activity. The presence of the amino group (-NH2) suggests that it can participate in various nucleophilic reactions, while the thiol group (-SH) can form disulfide bonds and is known for its reducing properties. The hex-1-enofuranos-3-ulose component indicates a furanose sugar structure with an unsaturated bond, which may influence the compound's stereochemistry and reactivity. This compound may exhibit properties such as solubility in polar solvents, potential for hydrogen bonding, and the ability to undergo oxidation or reduction reactions. Its unique structure could also suggest potential applications in medicinal chemistry or biochemistry, particularly in the development of pharmaceuticals or as a biochemical probe. However, specific applications and biological activities would require further investigation and characterization.
Formula:C8H15NO6S
InChI:InChI=1/C6H8O6.C2H7NS/c7-1-2(8)5-3(9)4(10)6(11)12-5;3-1-2-4/h2,5,7-8,10-11H,1H2;4H,1-3H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mercamine ascorbate
CAS:Mercamine ascorbate is a bioactive chemical.Formula:C8H15NO6SColor and Shape:SolidMolecular weight:253.27
