CAS 16033-28-6
:N,N'-dihydroxy-9-pentofuranosyl-9H-purine-2,6-diamine
Description:
N,N'-dihydroxy-9-pentofuranosyl-9H-purine-2,6-diamine, also known by its CAS number 16033-28-6, is a purine derivative characterized by its structural features that include a pentofuranosyl sugar moiety and two hydroxyl groups attached to the nitrogen atoms. This compound is a nucleoside analog, which means it resembles the structure of natural nucleosides, potentially influencing nucleic acid metabolism. The presence of the hydroxyl groups contributes to its reactivity and solubility in polar solvents, making it suitable for various biochemical applications. Its purine base structure is essential for interactions with nucleic acids, and it may exhibit biological activity, including potential antiviral or anticancer properties. The compound's stability, solubility, and reactivity can be influenced by pH and temperature, which are critical factors in its handling and application in laboratory settings. Overall, N,N'-dihydroxy-9-pentofuranosyl-9H-purine-2,6-diamine is of interest in medicinal chemistry and biochemistry for its potential therapeutic applications.
Formula:C10H14N6O6
InChI:InChI=1/C10H14N6O6/c17-1-3-5(18)6(19)9(22-3)16-2-11-4-7(14-20)12-10(15-21)13-8(4)16/h2-3,5-6,9,17-21H,1H2,(H2,12,13,14,15)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Regadenoson Impurity 29
CAS:Regadenoson Impurity 29 is a synthetic impurity of the drug Regadenoson that has been used in Metabolism studies, Natural, API impurity, Custom synthesis, Impurity standard, Synthetic, Drug development, Research and Development. It is a high purity analytical standard that can be used as a CAS No. 16033-28-6 HPLC standard or as a High purity pharmacopoeia.Formula:C10H14N6O6Purity:Min. 95%Molecular weight:314.26 g/mol



