CAS 16034-48-3

2-(1H-Pyrazol-1-yl)acetic acid

Description:

2-(1H-Pyrazol-1-yl)acetic acid, with the CAS number 16034-48-3, is an organic compound characterized by the presence of a pyrazole ring and a carboxylic acid functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its carboxylic acid group. It exhibits acidic properties, which can influence its reactivity and interactions with other chemical species. The pyrazole moiety contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound may participate in various chemical reactions, including esterification and amidation, due to the presence of the carboxylic acid. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₅H₆N₂O₂

InChI: InChI=1/C5H6N2O2/c8-5(9)4-7-3-1-2-6-7/h1-3H,4H2,(H,8,9)

SMILES: c1cnn(c1)CC(=O)O

Synonyms:

• 1H-Pyrazol-1-ylacetic acid
• 1H-Pyrazole-1-acetic acid

1H-Pyrazole-1-acetic acid

CAS: 16034-48-3

Formula: C₅H₆N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 126.1133

Ref: IN-DA001RUU

1H-pyrazol-1-ylacetic acid

CAS: 16034-48-3

1H-pyrazol-1-ylacetic acid

Purity: 97%

Molecular weight: 126.11g/mol

Ref: 54-OR95882

1H-Pyrazol-1-yl acetic acid

CAS: 16034-48-3

Formula: C₅H₆N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 126.115

Ref: 10-F043043