CymitQuimica logo

CAS 160351-97-3

:

Cyclobutanecarboxylic acid, 3-hydroxy-, ethyl ester, cis- (9CI)

Description:
Cyclobutanecarboxylic acid, 3-hydroxy-, ethyl ester, cis- (9CI) is an organic compound characterized by its cyclobutane ring structure, which is a four-membered cyclic alkane. This compound features a carboxylic acid functional group and an ethyl ester moiety, indicating it is an ester derivative of cyclobutanecarboxylic acid. The presence of a hydroxyl group at the 3-position contributes to its reactivity and potential for hydrogen bonding, which can influence its solubility and boiling point. The "cis-" designation indicates that the substituents on the cyclobutane ring are oriented on the same side, affecting the compound's stereochemistry and potentially its biological activity. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its unique structural features. Its CAS number, 160351-97-3, allows for precise identification in chemical databases. Overall, cyclobutanecarboxylic acid, 3-hydroxy-, ethyl ester, cis- is a versatile compound with potential applications in research and industry.
Formula:C7H12O3
InChI:InChI=1/C7H12O3/c1-2-10-7(9)5-3-6(8)4-5/h5-6,8H,2-4H2,1H3/t5-,6+
InChI key:KTVUZBJHOAPDGC-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CC(C1)O
Found 3 products.