CAS 160377-48-0: 5-(4-iodophenyl)isoxazole
Description:5-(4-Iodophenyl)isoxazole is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of the 4-iodophenyl group indicates that there is an iodine atom attached to a phenyl ring at the para position relative to the isoxazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the iodine substituent, which can participate in various chemical reactions, including nucleophilic substitutions. The isoxazole ring contributes to the compound's stability and can influence its biological activity, making it of interest in medicinal chemistry. Additionally, the iodine atom can enhance the compound's lipophilicity and may affect its pharmacokinetic properties. Overall, 5-(4-iodophenyl)isoxazole is a compound of interest for research in organic synthesis and potential applications in pharmaceuticals.
Formula:C9H6INO
InChI:InChI=1/C9H6INO/c10-8-3-1-7(2-4-8)9-5-6-11-12-9/h1-6H
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 5-(4-Iodophenyl)isoxazole REF: 10-F752246CAS: 160377-48-0 | 98% | 107.00 €~221.00 € | Tue 15 Apr 25 |
 | Isoxazole, 5-(4-iodophenyl)- REF: IN-DA001RW6CAS: 160377-48-0 | - - - | To inquire | Thu 17 Apr 25 |
 | 5-(4-Iodophenyl)isoxazole REF: 54-OR23193CAS: 160377-48-0 | - - - | 89.00 €~166.00 € | Mon 21 Apr 25 |
 | 5-(4-Iodophenyl)-1,2-oxazole REF: 3D-KGA37748CAS: 160377-48-0 | Min. 95% | - - - | Discontinued product |
Ref: 10-F752246
| 1g | 221.00 € | ||
| 250mg | 107.00 € |
Ref: IN-DA001RW6
| Undefined size | To inquire |
Ref: 54-OR23193
| 1g | 166.00 € | ||
| 250mg | 89.00 € |
5-(4-Iodophenyl)-1,2-oxazole
Ref: 3D-KGA37748
| 1g | Discontinued | Request information | |
| 100mg | Discontinued | Request information |
