CAS 160388-53-4

4-(1H-PYRAZOL-1-YLMETHYL)BENZOIC ACID

Description:

4-(1H-Pyrazol-1-ylmethyl)benzoic acid, with the CAS number 160388-53-4, is an organic compound characterized by its pyrazole and benzoic acid functional groups. This compound features a pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms, attached to a benzoic acid moiety through a methylene (-CH2-) bridge. The presence of the carboxylic acid group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or analgesic agents, as well as in materials science for the synthesis of novel polymers or ligands. Additionally, the compound's reactivity and functional groups make it a candidate for further chemical modifications to enhance its properties or biological activity.

Formula: C₁₁H₁₀N₂O₂

InChI: InChI=1/C11H10N2O2/c14-11(15)10-4-2-9(3-5-10)8-13-7-1-6-12-13/h1-7H,8H2,(H,14,15)

SMILES: c1cnn(c1)Cc1ccc(cc1)C(=O)O

Synonyms:

• Asinex-Reag Bas 10157013
• 4-Pyrazol-1-Ylmethyl-Benzoic Acid
• Akos Pao-0076
• Timtec-Bb Sbb011031
• 4-(1H-Pyrazol-1-ylmethyl)benzoic acid 97%

4-(1H-Pyrazol-1-ylmethyl)benzoic acid

CAS: 160388-53-4

Formula: C₁₁H₁₀N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 202.2093

Ref: IN-DA001RVW

4-[(1H-Pyrazol-1-yl)methyl]benzoic acid

CAS: 160388-53-4

4-[(1H-Pyrazol-1-yl)methyl]benzoic acid

Purity: 97%

Molecular weight: 202.21g/mol

Ref: 54-OR9645

4-Pyrazol-1-ylmethyl-benzoic acid

CAS: 160388-53-4

Formula: C₁₁H₁₀N₂O₂

Purity: 98%

Molecular weight: 202.213

Ref: 10-F059263