CAS 160399-35-9
:AK 295
Description:
AK 295, identified by its CAS number 160399-35-9, is a chemical compound that belongs to a specific class of substances known for their potential applications in various fields, including pharmaceuticals and materials science. While detailed characteristics such as its molecular structure, physical properties, and specific uses may vary, compounds like AK 295 typically exhibit unique reactivity profiles, solubility characteristics, and biological activity. The compound may possess functional groups that influence its interactions with other molecules, making it of interest for research and development. Additionally, safety data sheets and regulatory information would provide insights into its handling, toxicity, and environmental impact. For precise applications and characteristics, consulting specialized literature or databases is recommended, as they can provide comprehensive details tailored to specific research or industrial needs.
Formula:C26H40N4O6
InChI:InChI=1/C26H40N4O6/c1-4-21(23(31)25(33)27-11-8-12-30-13-15-35-16-14-30)28-24(32)22(17-19(2)3)29-26(34)36-18-20-9-6-5-7-10-20/h5-7,9-10,19,21-22H,4,8,11-18H2,1-3H3,(H,27,33)(H,28,32)(H,29,34)/t21?,22-/m0/s1
Synonyms:- Cbz-leu-abu-conh(CH2)3-mpl
- Carbamic acid, ((1S)-1-(((1-ethyl-3-((3-(4-morpholinyl)propyl)amino)-2,3-dioxopropyl)amino)carbonyl)-3-methylbutyl)-, phenylmethyl ester
- AK-295
- CX 295
- Cbz-leu-aminobutyrate-conh(CH2)3-morpholine
- Carbamic acid, (1-(((1-ethyl-3-((3-(4-morpholinyl)propyl)amino)-2,3-dioxopropyl)amino)carbonyl)-3-methylbutyl)-, phenylmethyl ester, stereoisomer
- N~2~-[(benzyloxy)carbonyl]-N-(1-{[3-(morpholin-4-yl)propyl]amino}-1,2-dioxopentan-3-yl)-L-leucinamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AK-295
CAS:AK 295, also known as CX 295, is a dipeptide inhibitor of alpha-ketoamide calpain.Formula:C26H40N4O6Color and Shape:SolidMolecular weight:504.62
